Difference between revisions of "ALLO-THR"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite Donor-H2 == * common-name: ** an reduced unknown electron acceptor == Reaction(s) known to consume the compound == * ADENYLYLSULFATE-RE...")
(Created page with "Category:metabolite == Metabolite CPD-7418 == * smiles: ** c(c=cc1(=c(c=cc=c1)o))(=o)[o-] * common-name: ** coumarinate * inchi-key: ** pmowtihvnwzyfi-waywqwqtsa-m * molec...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite Donor-H2 ==
+
== Metabolite CPD-7418 ==
 +
* smiles:
 +
** c(c=cc1(=c(c=cc=c1)o))(=o)[o-]
 
* common-name:
 
* common-name:
** an reduced unknown electron acceptor
+
** coumarinate
 +
* inchi-key:
 +
** pmowtihvnwzyfi-waywqwqtsa-m
 +
* molecular-weight:
 +
** 163.152
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ADENYLYLSULFATE-REDUCTASE-RXN]]
+
* [[RXN-8037]]
* [[CHD-RXN]]
 
* [[DEOXYHYPUSINE-MONOOXYGENASE-RXN]]
 
* [[NADH-DEHYDROGENASE-RXN]]
 
* [[R07063]]
 
* [[R07861]]
 
* [[RXN-10851]]
 
* [[RXN-11334]]
 
* [[RXN-12473]]
 
* [[RXN-13445]]
 
* [[RXN-13682]]
 
* [[RXN-14480]]
 
* [[RXN-8667]]
 
* [[RXN0-2023]]
 
* [[RXN0-5063]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ADENYLYLSULFATE-REDUCTASE-RXN]]
+
* [[RXN-8036]]
* [[CHD-RXN]]
 
* [[NADH-DEHYDROGENASE-RXN]]
 
* [[R07861]]
 
* [[RXN-10851]]
 
* [[RXN-10981]]
 
* [[RXN-11334]]
 
* [[RXN-13682]]
 
* [[RXN-14480]]
 
* [[RXN-14642]]
 
* [[RXN-6081]]
 
* [[THIOREDOXIN-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=an reduced unknown electron acceptor}}
+
{{#set: common-name=coumarinate}}
 +
{{#set: inchi-key=inchikey=pmowtihvnwzyfi-waywqwqtsa-m}}
 +
{{#set: molecular-weight=163.152}}

Revision as of 15:47, 12 January 2021

Metabolite CPD-7418

  • smiles:
    • c(c=cc1(=c(c=cc=c1)o))(=o)[o-]
  • common-name:
    • coumarinate
  • inchi-key:
    • pmowtihvnwzyfi-waywqwqtsa-m
  • molecular-weight:
    • 163.152

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality