Difference between revisions of "Cellodextrins"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite OXYGEN-MOLECULE == * smiles: ** o=o * common-name: ** oxygen * inchi-key: ** mymofizgzyhomd-uhfffaoysa-n * molecular-weight: ** 31.999 ==...")
(Created page with "Category:metabolite == Metabolite CPD-4618 == * smiles: ** cc(=ccnc1(c2(=c(n=cn=1)n=cn2c3(c(c(c(c(o3)co)o)o)o))))co * common-name: ** cis-zeatin-7-n-glucoside * inchi-key:...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite OXYGEN-MOLECULE ==
+
== Metabolite CPD-4618 ==
 
* smiles:
 
* smiles:
** o=o
+
** cc(=ccnc1(c2(=c(n=cn=1)n=cn2c3(c(c(c(c(o3)co)o)o)o))))co
 
* common-name:
 
* common-name:
** oxygen
+
** cis-zeatin-7-n-glucoside
 
* inchi-key:
 
* inchi-key:
** mymofizgzyhomd-uhfffaoysa-n
+
** htdhrclvwuexis-gihywfgssa-n
 
* molecular-weight:
 
* molecular-weight:
** 31.999
+
** 381.388
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 
* [[1.14.11.18-RXN]]
 
* [[1.14.11.2-RXN]]
 
* [[1.14.13.70-RXN]]
 
* [[1.14.13.79-RXN]]
 
* [[1.14.13.8-RXN]]
 
* [[1.14.19.1-RXN]]
 
* [[1.14.19.3-RXN]]
 
* [[1.14.21.6-RXN]]
 
* [[1.21.3.1-RXN]]
 
* [[1.8.3.5-RXN]]
 
* [[4-HYDROXYPHENYLPYRUVATE-DIOXYGENASE-RXN]]
 
* [[ACYL-COA-OXIDASE-RXN]]
 
* [[AMACETOXID-RXN]]
 
* [[AMINEOXID-RXN]]
 
* [[AMINEPHEN-RXN]]
 
* [[ARGININE-2-MONOOXYGENASE-RXN]]
 
* [[CYSTEAMINE-DIOXYGENASE-RXN]]
 
* [[CYSTEINE-DIOXYGENASE-RXN]]
 
* [[CYTOCHROME-C-OXIDASE-RXN]]
 
* [[DEOXYHYPUSINE-MONOOXYGENASE-RXN]]
 
* [[DOPAMINE-BETA-MONOOXYGENASE-RXN]]
 
* [[ExchangeSeed_OXYGEN-MOLECULE]]
 
* [[HOMOGENTISATE-12-DIOXYGENASE-RXN]]
 
* [[INDOLE-23-DIOXYGENASE-RXN]]
 
* [[KYNURENINE-3-MONOOXYGENASE-RXN]]
 
* [[L-ASPARTATE-OXID-RXN]]
 
* [[MONOPHENOL-MONOOXYGENASE-RXN]]
 
* [[MYO-INOSITOL-OXYGENASE-RXN]]
 
* [[NARINGENIN-3-DIOXYGENASE-RXN]]
 
* [[PEPTIDE-ASPARTATE-BETA-DIOXYGENASE-RXN]]
 
* [[PMPOXI-RXN]]
 
* [[PNPOXI-RXN]]
 
* [[PROTOPORGENOXI-RXN]]
 
* [[QUINOLINATE-SYNTHE-MULTI-RXN]]
 
* [[R07063]]
 
* [[R07861]]
 
* [[R147-RXN]]
 
* [[RXN-10664]]
 
* [[RXN-10696]]
 
* [[RXN-10706]]
 
* [[RXN-10707]]
 
* [[RXN-10745]]
 
* [[RXN-10815]]
 
* [[RXN-11026]]
 
* [[RXN-11056]]
 
* [[RXN-11057]]
 
* [[RXN-1121]]
 
* [[RXN-113]]
 
* [[RXN-115]]
 
* [[RXN-11519]]
 
* [[RXN-11520]]
 
* [[RXN-11521]]
 
* [[RXN-11784]]
 
* [[RXN-11881]]
 
* [[RXN-11887]]
 
* [[RXN-11989]]
 
* [[RXN-12518]]
 
* [[RXN-12669]]
 
* [[RXN-12869]]
 
* [[RXN-13061]]
 
* [[RXN-13064]]
 
* [[RXN-1321]]
 
* [[RXN-13398]]
 
* [[RXN-13426]]
 
* [[RXN-13707]]
 
* [[RXN-13883]]
 
* [[RXN-13892]]
 
* [[RXN-13961]]
 
* [[RXN-14576]]
 
* [[RXN-14771]]
 
* [[RXN-14775]]
 
* [[RXN-14785]]
 
* [[RXN-14789]]
 
* [[RXN-14796]]
 
* [[RXN-15684]]
 
* [[RXN-15830]]
 
* [[RXN-16065]]
 
* [[RXN-16132]]
 
* [[RXN-16134]]
 
* [[RXN-16226]]
 
* [[RXN-16378]]
 
* [[RXN-171]]
 
* [[RXN-17105]]
 
* [[RXN-17112]]
 
* [[RXN-17113]]
 
* [[RXN-17252]]
 
* [[RXN-17625]]
 
* [[RXN-17627]]
 
* [[RXN-3661]]
 
* [[RXN-4209]]
 
* [[RXN-4225]]
 
* [[RXN-4231]]
 
* [[RXN-527]]
 
* [[RXN-5821]]
 
* [[RXN-5861]]
 
* [[RXN-602]]
 
* [[RXN-6381]]
 
* [[RXN-6550]]
 
* [[RXN-6883]]
 
* [[RXN-715]]
 
* [[RXN-7648]]
 
* [[RXN-7676]]
 
* [[RXN-7677]]
 
* [[RXN-773]]
 
* [[RXN-7740]]
 
* [[RXN-7775]]
 
* [[RXN-7922]]
 
* [[RXN-8450]]
 
* [[RXN-8497]]
 
* [[RXN-8630]]
 
* [[RXN-8664]]
 
* [[RXN-8665]]
 
* [[RXN-8872]]
 
* [[RXN-9597]]
 
* [[RXN-9601]]
 
* [[RXN-961]]
 
* [[RXN-969]]
 
* [[RXN0-1461]]
 
* [[RXN0-5265]]
 
* [[RXN1F-160]]
 
* [[RXN1F-161]]
 
* [[RXN1F-162]]
 
* [[RXN1F-163]]
 
* [[RXN1F-165]]
 
* [[RXN1F-167]]
 
* [[RXN1F-168]]
 
* [[RXN1F-93]]
 
* [[RXN3O-130]]
 
* [[RXN3O-218]]
 
* [[RXN490-3641]]
 
* [[RXN66-11]]
 
* [[RXN66-12]]
 
* [[RXN66-13]]
 
* [[RXN66-146]]
 
* [[RXN66-161]]
 
* [[RXN66-163]]
 
* [[RXN66-169]]
 
* [[RXN66-181]]
 
* [[RXN66-303]]
 
* [[RXN66-304]]
 
* [[RXN66-305]]
 
* [[RXN66-470]]
 
* [[RXN66-569]]
 
* [[RXN66-81]]
 
* [[RXN6666-4]]
 
* [[S-2-HYDROXY-ACID-OXIDASE-RXN]]
 
* [[SQUALENE-MONOOXYGENASE-RXN]]
 
* [[THIOL-OXIDASE-RXN]]
 
* [[TransportSeed_OXYGEN-MOLECULE]]
 
* [[UNSPECIFIC-MONOOXYGENASE-RXN]]
 
* [[URATE-OXIDASE-RXN]]
 
* [[XANTHINE-OXIDASE-RXN]]
 
</div>
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[CATAL-RXN]]
+
* [[RXN-4733]]
* [[ExchangeSeed_OXYGEN-MOLECULE]]
 
* [[PSII-RXN]]
 
* [[R07861]]
 
* [[RXN-16378]]
 
* [[RXN-17625]]
 
* [[SUPEROX-DISMUT-RXN]]
 
* [[TransportSeed_OXYGEN-MOLECULE]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=oxygen}}
+
{{#set: common-name=cis-zeatin-7-n-glucoside}}
{{#set: inchi-key=inchikey=mymofizgzyhomd-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=htdhrclvwuexis-gihywfgssa-n}}
{{#set: molecular-weight=31.999}}
+
{{#set: molecular-weight=381.388}}

Revision as of 15:49, 12 January 2021

Metabolite CPD-4618

  • smiles:
    • cc(=ccnc1(c2(=c(n=cn=1)n=cn2c3(c(c(c(c(o3)co)o)o)o))))co
  • common-name:
    • cis-zeatin-7-n-glucoside
  • inchi-key:
    • htdhrclvwuexis-gihywfgssa-n
  • molecular-weight:
    • 381.388

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality