Difference between revisions of "Thiols"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite NICOTINAMIDE_NUCLEOTIDE == * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c(o1)[n+]2(c=cc=c(c(=o)n)c=2)) * common-name: ** β-nicotinamid...") |
(Created page with "Category:metabolite == Metabolite Long-Chain-Aldehydes == * common-name: ** a long-chain aldehyde == Reaction(s) known to consume the compound == * LONG-CHAIN-FATTY-ACYL...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Long-Chain-Aldehydes == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** a long-chain aldehyde |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN | + | * [[LONG-CHAIN-FATTY-ACYL-COA-REDUCTASE-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[LONG-CHAIN-FATTY-ACYL-COA-REDUCTASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a long-chain aldehyde}} |
| − | |||
| − | |||
Revision as of 18:34, 12 January 2021
Contents
Metabolite Long-Chain-Aldehydes
- common-name:
- a long-chain aldehyde
