Difference between revisions of "Cellodextrins"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-4618 == * smiles: ** cc(=ccnc1(c2(=c(n=cn=1)n=cn2c3(c(c(c(c(o3)co)o)o)o))))co * common-name: ** cis-zeatin-7-n-glucoside * inchi-key:...") |
(Created page with "Category:metabolite == Metabolite PROTEIN-L-BETA-ISOSPARTATE-METHYL-ESTERS == * common-name: ** a protein l-β-isoaspartate α-methyl ester == Reaction(s) known t...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite PROTEIN-L-BETA-ISOSPARTATE-METHYL-ESTERS == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** a protein l-β-isoaspartate α-methyl ester |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[2.1.1.77-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a protein l-β-isoaspartate α-methyl ester}} |
| − | |||
| − | |||
Revision as of 18:38, 12 January 2021
Contents
Metabolite PROTEIN-L-BETA-ISOSPARTATE-METHYL-ESTERS
- common-name:
- a protein l-β-isoaspartate α-methyl ester
