Difference between revisions of "GLY-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite N-5-PHOSPHORIBOSYL-ANTHRANILATE == * smiles: ** c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)nc2(c=cc=cc(c(=o)[o-])=2)) * common-name: ** n-(5-phos...") |
(Created page with "Category:metabolite == Metabolite CPD-13755 == * smiles: ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)ccc1(c(o)ccc2(c)(c(=o)cc[ch]12)))cop(=o)(op(=o)(occ3(c(op([o-])(=o)[o-])c(o)c(o...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-13755 == |
* smiles: | * smiles: | ||
| − | ** c(op(=o)([o-])[o-]) | + | ** cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)ccc1(c(o)ccc2(c)(c(=o)cc[ch]12)))cop(=o)(op(=o)(occ3(c(op([o-])(=o)[o-])c(o)c(o3)n5(c4(=c(c(n)=nc=n4)n=c5))))[o-])[o-] |
* common-name: | * common-name: | ||
| − | ** | + | ** 5-hydroxy-3-[(3as,4s,5r,7as)-7a-methyl-1,5-dioxo-octahydro-1h-inden-4-yl]propanoyl-coa |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** akniqsrwpadumx-odlrqibisa-j |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 985.786 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-12747]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=5-hydroxy-3-[(3as,4s,5r,7as)-7a-methyl-1,5-dioxo-octahydro-1h-inden-4-yl]propanoyl-coa}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=akniqsrwpadumx-odlrqibisa-j}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=985.786}} |
Revision as of 18:41, 12 January 2021
Contents
Metabolite CPD-13755
- smiles:
- cc(c)(c(o)c(=o)nccc(=o)nccsc(=o)ccc1(c(o)ccc2(c)(c(=o)cc[ch]12)))cop(=o)(op(=o)(occ3(c(op([o-])(=o)[o-])c(o)c(o3)n5(c4(=c(c(n)=nc=n4)n=c5))))[o-])[o-]
- common-name:
- 5-hydroxy-3-[(3as,4s,5r,7as)-7a-methyl-1,5-dioxo-octahydro-1h-inden-4-yl]propanoyl-coa
- inchi-key:
- akniqsrwpadumx-odlrqibisa-j
- molecular-weight:
- 985.786
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "5-hydroxy-3-[(3as,4s,5r,7as)-7a-methyl-1,5-dioxo-octahydro-1h-inden-4-yl]propanoyl-coa" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
