Difference between revisions of "DNA-Adjacent-Pyrimidines"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite THREO-DS-ISO-CITRATE == * smiles: ** c(=o)(c(cc([o-])=o)c(o)c([o-])=o)[o-] * common-name: ** d-threo-isocitrate * inchi-key: ** odblhexud...")
(Created page with "Category:metabolite == Metabolite 4-hydroxybenzoate == * smiles: ** c(c1(c=cc(=cc=1)o))(=o)[o-] * common-name: ** 4-hydroxybenzoate * inchi-key: ** fjkrolugyxjwqn-uhfffaoy...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite THREO-DS-ISO-CITRATE ==
+
== Metabolite 4-hydroxybenzoate ==
 
* smiles:
 
* smiles:
** c(=o)(c(cc([o-])=o)c(o)c([o-])=o)[o-]
+
** c(c1(c=cc(=cc=1)o))(=o)[o-]
 
* common-name:
 
* common-name:
** d-threo-isocitrate
+
** 4-hydroxybenzoate
 
* inchi-key:
 
* inchi-key:
** odblhexudapzau-zafykaaxsa-k
+
** fjkrolugyxjwqn-uhfffaoysa-m
 
* molecular-weight:
 
* molecular-weight:
** 189.101
+
** 137.115
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ACONITATEHYDR-RXN]]
+
* [[2.5.1.39-RXN]]
* [[ISOCIT-CLEAV-RXN]]
+
* [[4OHBENZOATE-OCTAPRENYLTRANSFER-RXN]]
* [[ISOCITDEH-RXN]]
+
* [[RXN-11368]]
* [[RXN-14047]]
+
* [[RXN-9003]]
* [[RXN-9951]]
+
* [[RXN-9222]]
* [[biomass_rxn]]
+
* [[RXN-9230]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ACONITATEHYDR-RXN]]
+
* [[RXN-11368]]
* [[ISOCIT-CLEAV-RXN]]
 
* [[ISOCITDEH-RXN]]
 
* [[RXN-14047]]
 
* [[RXN-9951]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=d-threo-isocitrate}}
+
{{#set: common-name=4-hydroxybenzoate}}
{{#set: inchi-key=inchikey=odblhexudapzau-zafykaaxsa-k}}
+
{{#set: inchi-key=inchikey=fjkrolugyxjwqn-uhfffaoysa-m}}
{{#set: molecular-weight=189.101}}
+
{{#set: molecular-weight=137.115}}

Revision as of 15:27, 13 January 2021

Metabolite 4-hydroxybenzoate

  • smiles:
    • c(c1(c=cc(=cc=1)o))(=o)[o-]
  • common-name:
    • 4-hydroxybenzoate
  • inchi-key:
    • fjkrolugyxjwqn-uhfffaoysa-m
  • molecular-weight:
    • 137.115

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality