Difference between revisions of "CPD-458"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PHOSPHORIBOSYL-ATP == * smiles: ** c(c4(c(c(c(n3(c(c2(=c(n(c1(c(c(c(o1)cop(op(=o)([o-])op(=o)([o-])o)(=o)[o-])o)o))c=n2)n=c3))=n))o4)o)o)...")
(Created page with "Category:metabolite == Metabolite Charged-ALA-tRNAs == * common-name: ** an l-alanyl-[trnaala] == Reaction(s) known to consume the compound == == Reaction(s) known to prod...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PHOSPHORIBOSYL-ATP ==
+
== Metabolite Charged-ALA-tRNAs ==
* smiles:
 
** c(c4(c(c(c(n3(c(c2(=c(n(c1(c(c(c(o1)cop(op(=o)([o-])op(=o)([o-])o)(=o)[o-])o)o))c=n2)n=c3))=n))o4)o)o))op([o-])([o-])=o
 
 
* common-name:
 
* common-name:
** 1-(5-phospho-β-d-ribosyl)-atp
+
** an l-alanyl-[trnaala]
* inchi-key:
 
** rknhjbvbfhdxgr-keohhstqsa-i
 
* molecular-weight:
 
** 714.24
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[ATPPHOSPHORIBOSYLTRANS-RXN]]
 
* [[HISTPRATPHYD-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[ATPPHOSPHORIBOSYLTRANS-RXN]]
+
* [[ALANINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1-(5-phospho-β-d-ribosyl)-atp}}
+
{{#set: common-name=an l-alanyl-[trnaala]}}
{{#set: inchi-key=inchikey=rknhjbvbfhdxgr-keohhstqsa-i}}
 
{{#set: molecular-weight=714.24}}
 

Revision as of 15:28, 13 January 2021

Metabolite Charged-ALA-tRNAs

  • common-name:
    • an l-alanyl-[trnaala]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Property "Common-name" (as page type) with input value "an l-alanyl-[trnaala" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.