Difference between revisions of "CPD-458"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18085 == * smiles: ** c5(n(c1(oc(c(c1o)o)cop(op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)op([o-])([o-])=o)o))([o-])=o)(=o)[o-]))cc(=c...")
(Created page with "Category:metabolite == Metabolite ATP == * smiles: ** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op(=o)([o-])op(=o)([o-])[o-])([o-])=o * common-name: ** atp * inchi-...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-18085 ==
+
== Metabolite ATP ==
 
* smiles:
 
* smiles:
** c5(n(c1(oc(c(c1o)o)cop(op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)op([o-])([o-])=o)o))([o-])=o)(=o)[o-]))cc(=cc=5)c(=o)n)
+
** c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op(=o)([o-])op(=o)([o-])[o-])([o-])=o
 
* common-name:
 
* common-name:
** 1,2-dihydro-β-nadp
+
** atp
 
* inchi-key:
 
* inchi-key:
** snzsfaqyvlpebz-nnyoxohssa-j
+
** zkhqwzamyrwxga-kqynxxcusa-j
 
* molecular-weight:
 
* molecular-weight:
** 741.394
+
** 503.152
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[1-PHOSPHATIDYLINOSITOL-3-KINASE-RXN]]
 +
* [[1-PHOSPHATIDYLINOSITOL-KINASE-RXN]]
 +
* [[2.7.1.127-RXN]]
 +
* [[2.7.1.133-RXN]]
 +
* [[2.7.1.134-RXN]]
 +
* [[2.7.1.139-RXN]]
 +
* [[2.7.1.140-RXN]]
 +
* [[2.7.1.148-RXN]]
 +
* [[2.7.1.149-RXN]]
 +
* [[2.7.1.150-RXN]]
 +
* [[2.7.1.153-RXN]]
 +
* [[2.7.1.154-RXN]]
 +
* [[2.7.1.68-RXN]]
 +
* [[2.7.10.1-RXN]]
 +
* [[2.7.11.2-RXN]]
 +
* [[2.7.11.24-RXN]]
 +
* [[2.7.11.4-RXN]]
 +
* [[2.7.12.1-RXN]]
 +
* [[2.7.12.2-RXN]]
 +
* [[2.7.13.3-RXN]]
 +
* [[2.7.9.3-RXN]]
 +
* [[3.6.3.1-RXN]]
 +
* [[3.6.3.6-RXN]]
 +
* [[3.6.4.4-RXN]]
 +
* [[4-COUMARATE--COA-LIGASE-RXN]]
 +
* [[5-FORMYL-THF-CYCLO-LIGASE-RXN]]
 +
* [[5-OXOPROLINASE-ATP-HYDROLYSING-RXN]]
 +
* [[5.99.1.3-RXN]]
 +
* [[6-PHOSPHOFRUCTO-2-KINASE-RXN]]
 +
* [[6.1.1.24-RXN]]
 +
* [[6.2.1.34-RXN]]
 +
* [[6.3.2.25-RXN]]
 +
* [[6.3.4.10-RXN]]
 +
* [[6.3.4.11-RXN]]
 +
* [[6.3.4.9-RXN]]
 +
* [[6.3.5.6-RXN]]
 +
* [[6.3.5.7-RXN]]
 +
* [[6PFRUCTPHOS-RXN]]
 +
* [[ACETATE--COA-LIGASE-RXN]]
 +
* [[ACETOACETATE--COA-LIGASE-RXN]]
 +
* [[ACETYL-COA-CARBOXYLTRANSFER-RXN]]
 +
* [[ACETYLGLUTKIN-RXN]]
 +
* [[ACYLCOASYN-RXN]]
 +
* [[ADENOSINE-KINASE-RXN]]
 +
* [[ADENYL-KIN-RXN]]
 +
* [[ADENYLATECYC-RXN]]
 +
* [[ADENYLYLSULFKIN-RXN]]
 +
* [[ALANINE--TRNA-LIGASE-RXN]]
 +
* [[APYRASE-RXN]]
 +
* [[ARGININE--TRNA-LIGASE-RXN]]
 +
* [[ARGSUCCINSYN-RXN]]
 +
* [[ASNSYNA-RXN]]
 +
* [[ASNSYNB-RXN]]
 +
* [[ASPARAGINE--TRNA-LIGASE-RXN]]
 +
* [[ASPARTATE--TRNA-LIGASE-RXN]]
 +
* [[ASPARTATEKIN-RXN]]
 +
* [[ATP-ADENYLYLTRANSFERASE-RXN]]
 +
* [[ATP-CITRATE-PRO-S--LYASE-RXN]]
 +
* [[ATPASE-RXN]]
 +
* [[ATPPHOSPHORIBOSYLTRANS-RXN]]
 +
* [[ATPSYN-RXN]]
 +
* [[BIOTINLIG-RXN]]
 +
* [[BTUR2-RXN]]
 +
* [[CARBAMATE-KINASE-RXN]]
 +
* [[CARBPSYN-RXN]]
 +
* [[CDPKIN-RXN]]
 +
* [[CHOLINE-KINASE-RXN]]
 +
* [[COBALADENOSYLTRANS-RXN]]
 +
* [[CREATINE-KINASE-RXN]]
 +
* [[CTPSYN-RXN]]
 +
* [[CYSTEINE--TRNA-LIGASE-RXN]]
 +
* [[CYTIKIN-RXN]]
 +
* [[DADPKIN-RXN]]
 +
* [[DCDPKIN-RXN]]
 +
* [[DEPHOSPHOCOAKIN-RXN]]
 +
* [[DETHIOBIOTIN-SYN-RXN]]
 +
* [[DGDPKIN-RXN]]
 +
* [[DIACYLGLYKIN-RXN]]
 +
* [[DIHYDROFOLATESYNTH-RXN]]
 +
* [[DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN]]
 +
* [[DNA-LIGASE-ATP-RXN]]
 +
* [[DTDPKIN-RXN]]
 +
* [[DTMPKI-RXN]]
 +
* [[DUDPKIN-RXN]]
 +
* [[ETHANOLAMINE-KINASE-RXN]]
 +
* [[FADSYN-RXN]]
 +
* [[FGAMSYN-RXN]]
 +
* [[FOLYLPOLYGLUTAMATESYNTH-RXN]]
 +
* [[FORMATETHFLIG-RXN]]
 +
* [[FORMYLTHFGLUSYNTH-RXN]]
 +
* [[FRUCTOKINASE-RXN]]
 +
* [[FUCOKINASE-RXN]]
 +
* [[GALACTOKIN-RXN]]
 +
* [[GDPKIN-RXN]]
 +
* [[GDPPYPHOSKIN-RXN]]
 +
* [[GLUCOKIN-RXN]]
 +
* [[GLURS-RXN]]
 +
* [[GLUTAMINE--TRNA-LIGASE-RXN]]
 +
* [[GLUTAMINESYN-RXN]]
 +
* [[GLUTATHIONE-SYN-RXN]]
 +
* [[GLUTCYSLIG-RXN]]
 +
* [[GLUTKIN-RXN]]
 +
* [[GLY3KIN-RXN]]
 +
* [[GLYCEROL-KIN-RXN]]
 +
* [[GLYCERONE-KINASE-RXN]]
 +
* [[GLYCINE--TRNA-LIGASE-RXN]]
 +
* [[GLYRIBONUCSYN-RXN]]
 +
* [[GMP-SYN-GLUT-RXN]]
 +
* [[GMP-SYN-NH3-RXN]]
 +
* [[GSADENYLATION-RXN]]
 +
* [[GTPPYPHOSKIN-RXN]]
 +
* [[GUANYL-KIN-RXN]]
 +
* [[H2PTERIDINEPYROPHOSPHOKIN-RXN]]
 +
* [[HEXOKINASE-RXN]]
 +
* [[HISTIDINE--TRNA-LIGASE-RXN]]
 +
* [[HOMOSERKIN-RXN]]
 +
* [[ISOLEUCINE--TRNA-LIGASE-RXN]]
 +
* [[LEUCINE--TRNA-LIGASE-RXN]]
 +
* [[LINOLENOYL-RXN]]
 +
* [[LYSINE--TRNA-LIGASE-RXN]]
 +
* [[METHIONINE--TRNA-LIGASE-RXN]]
 +
* [[METHYLCROTONYL-COA-CARBOXYLASE-RXN]]
 +
* [[MEVALONATE-KINASE-RXN]]
 +
* [[NAD-KIN-RXN]]
 +
* [[NAD-SYNTH-GLN-RXN]]
 +
* [[NAD-SYNTH-NH3-RXN]]
 +
* [[NICONUCADENYLYLTRAN-RXN]]
 +
* [[NICOTINATEPRIBOSYLTRANS-RXN]]
 +
* [[NUCLEOSIDE-DIP-KIN-RXN]]
 +
* [[PANTEPADENYLYLTRAN-RXN]]
 +
* [[PANTOATE-BETA-ALANINE-LIG-RXN]]
 +
* [[PANTOTHENATE-KIN-RXN]]
 +
* [[PEPCARBOXYKIN-RXN]]
 +
* [[PEPDEPHOS-RXN]]
 +
* [[PEPSYNTH-RXN]]
 +
* [[PHENYLALANINE--TRNA-LIGASE-RXN]]
 +
* [[PHOSGLYPHOS-RXN]]
 +
* [[PHOSPHOMEVALONATE-KINASE-RXN]]
 +
* [[PHOSPHORIBULOKINASE-RXN]]
 +
* [[PNKIN-RXN]]
 +
* [[POLYNUCLEOTIDE-ADENYLYLTRANSFERASE-RXN]]
 +
* [[PROLINE--TRNA-LIGASE-RXN]]
 +
* [[PROPIONYL-COA-CARBOXY-RXN]]
 +
* [[PROTEIN-KINASE-RXN]]
 +
* [[PRPPSYN-RXN]]
 +
* [[PSEUDOURIDINE-KINASE-RXN]]
 +
* [[PYRAMKIN-RXN]]
 +
* [[PYRIDOXKIN-RXN]]
 +
* [[PYRIMSYN3-RXN]]
 +
* [[PYRUVATE-CARBOXYLASE-RXN]]
 +
* [[PYRUVATEORTHOPHOSPHATE-DIKINASE-RXN]]
 +
* [[R223-RXN]]
 +
* [[R344-RXN]]
 +
* [[RIBOFLAVINKIN-RXN]]
 +
* [[RIBOKIN-RXN]]
 +
* [[RNA-3-PHOSPHATE-CYCLASE-RXN]]
 +
* [[RNA-LIGASE-ATP-RXN]]
 +
* [[RXN-10]]
 +
* [[RXN-10038]]
 +
* [[RXN-10919]]
 +
* [[RXN-11109]]
 +
* [[RXN-11135]]
 +
* [[RXN-1126]]
 +
* [[RXN-11361]]
 +
* [[RXN-11832]]
 +
* [[RXN-12002]]
 +
* [[RXN-12056]]
 +
* [[RXN-12184]]
 +
* [[RXN-12502]]
 +
* [[RXN-12503]]
 +
* [[RXN-12720]]
 +
* [[RXN-12978]]
 +
* [[RXN-13202]]
 +
* [[RXN-13290]]
 +
* [[RXN-13614]]
 +
* [[RXN-14120]]
 +
* [[RXN-14196]]
 +
* [[RXN-14223]]
 +
* [[RXN-14228]]
 +
* [[RXN-14325]]
 +
* [[RXN-14391]]
 +
* [[RXN-14569]]
 +
* [[RXN-14906]]
 +
* [[RXN-15005]]
 +
* [[RXN-15733]]
 +
* [[RXN-16165]]
 +
* [[RXN-16317]]
 +
* [[RXN-16380]]
 +
* [[RXN-16389]]
 +
* [[RXN-16393]]
 +
* [[RXN-16401]]
 +
* [[RXN-16402]]
 +
* [[RXN-16415]]
 +
* [[RXN-16418]]
 +
* [[RXN-16909]]
 +
* [[RXN-1961]]
 +
* [[RXN-2001]]
 +
* [[RXN-4303]]
 +
* [[RXN-7163]]
 +
* [[RXN-7904]]
 +
* [[RXN-7913]]
 +
* [[RXN-8344]]
 +
* [[RXN-8443]]
 +
* [[RXN-9386]]
 +
* [[RXN-9623]]
 +
* [[RXN-9644]]
 +
* [[RXN-9673]]
 +
* [[RXN0-1061]]
 +
* [[RXN0-2023]]
 +
* [[RXN0-2161]]
 +
* [[RXN0-2921]]
 +
* [[RXN0-4261]]
 +
* [[RXN0-5055]]
 +
* [[RXN0-7192]]
 +
* [[RXN0-7238]]
 +
* [[RXN0-7239]]
 +
* [[RXN0-7248]]
 +
* [[RXN0-745]]
 +
* [[RXN1F-20]]
 +
* [[RXN1G-121]]
 +
* [[RXN1G-4355]]
 +
* [[RXN3DJ-11417]]
 +
* [[RXN66-469]]
 +
* [[RXN66-474]]
 +
* [[RXN66-477]]
 +
* [[RXN66-480]]
 +
* [[RXN66-483]]
 +
* [[RXN66-484]]
 +
* [[S-ADENMETSYN-RXN]]
 +
* [[SAICARSYN-RXN]]
 +
* [[SERINE--TRNA-LIGASE-RXN]]
 +
* [[SHIKIMATE-KINASE-RXN]]
 +
* [[SUCCCOASYN-RXN]]
 +
* [[SULFATE-ADENYLYLTRANS-RXN]]
 +
* [[TAU-PROTEIN-KINASE-RXN]]
 +
* [[TCX8]]
 +
* [[THIAMIN-PYROPHOSPHOKINASE-RXN]]
 +
* [[THIAZOLSYN3-RXN]]
 +
* [[THREONINE--TRNA-LIGASE-RXN]]
 +
* [[TRANS-RXN0-623]]
 +
* [[TRYPTOPHAN--TRNA-LIGASE-RXN]]
 +
* [[TYROSINE--TRNA-LIGASE-RXN]]
 +
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
 +
* [[UDPKIN-RXN]]
 +
* [[URIDINEKIN-RXN]]
 +
* [[VALINE--TRNA-LIGASE-RXN]]
 +
* [[XYLULOKIN-RXN]]
 +
</div>
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-16765]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[2.7.11.2-RXN]]
 +
* [[2.7.11.24-RXN]]
 +
* [[2.7.11.4-RXN]]
 +
* [[2.7.12.1-RXN]]
 +
* [[2.7.12.2-RXN]]
 +
* [[5.99.1.3-RXN]]
 +
* [[ACETYLGLUTKIN-RXN]]
 +
* [[ADENYLYLSULFKIN-RXN]]
 +
* [[ASPARTATEKIN-RXN]]
 +
* [[ATP-ADENYLYLTRANSFERASE-RXN]]
 +
* [[ATPPHOSPHORIBOSYLTRANS-RXN]]
 +
* [[ATPSYN-RXN]]
 +
* [[CARBAMATE-KINASE-RXN]]
 +
* [[CREATINE-KINASE-RXN]]
 +
* [[GALACTOKIN-RXN]]
 +
* [[GLYCEROL-KIN-RXN]]
 +
* [[HEXOKINASE-RXN]]
 +
* [[MEVALONATE-KINASE-RXN]]
 +
* [[PEPDEPHOS-RXN]]
 +
* [[PHOSGLYPHOS-RXN]]
 +
* [[PHOSPHOMEVALONATE-KINASE-RXN]]
 +
* [[PHOSPHORIBULOKINASE-RXN]]
 +
* [[POLYNUCLEOTIDE-ADENYLYLTRANSFERASE-RXN]]
 +
* [[PROPIONYL-COA-CARBOXY-RXN]]
 +
* [[PRPPSYN-RXN]]
 +
* [[RXN-10038]]
 +
* [[RXN-11135]]
 +
* [[RXN-12502]]
 +
* [[RXN-12503]]
 +
* [[RXN-14120]]
 +
* [[RXN-14223]]
 +
* [[RXN-14228]]
 +
* [[RXN-14569]]
 +
* [[RXN-14906]]
 +
* [[RXN-16317]]
 +
* [[RXN-16415]]
 +
* [[RXN0-1061]]
 +
* [[SHIKIMATE-KINASE-RXN]]
 +
* [[SUCCCOASYN-RXN]]
 +
* [[SULFATE-ADENYLYLTRANS-RXN]]
 +
* [[TAU-PROTEIN-KINASE-RXN]]
 +
* [[TCX8]]
 +
</div>
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=1,2-dihydro-&beta;-nadp}}
+
{{#set: common-name=atp}}
{{#set: inchi-key=inchikey=snzsfaqyvlpebz-nnyoxohssa-j}}
+
{{#set: inchi-key=inchikey=zkhqwzamyrwxga-kqynxxcusa-j}}
{{#set: molecular-weight=741.394}}
+
{{#set: molecular-weight=503.152}}

Revision as of 09:20, 14 January 2021

Metabolite ATP

  • smiles:
    • c(c3(c(c(c(n2(c1(=c(c(=nc=n1)n)n=c2)))o3)o)o))op(op(=o)([o-])op(=o)([o-])[o-])([o-])=o
  • common-name:
    • atp
  • inchi-key:
    • zkhqwzamyrwxga-kqynxxcusa-j
  • molecular-weight:
    • 503.152

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality