Difference between revisions of "ALLO-THR"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11528 == * smiles: ** ccc=ccc4(c(=o)ccc(cc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2...")
(Created page with "Category:metabolite == Metabolite CPD-30 == * smiles: ** cc(nccc[ch]=o)=o * common-name: ** 4-acetamidobutanal * inchi-key: ** ddslgzoyepkpsj-uhfffaoysa-n * molecular-weig...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11528 ==
+
== Metabolite CPD-30 ==
 
* smiles:
 
* smiles:
** ccc=ccc4(c(=o)ccc(cc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])4)
+
** cc(nccc[ch]=o)=o
 
* common-name:
 
* common-name:
** opc4-3-ketoacyl-coa
+
** 4-acetamidobutanal
 
* inchi-key:
 
* inchi-key:
** qgjlcxxjefrwhp-bumuvwnnsa-j
+
** ddslgzoyepkpsj-uhfffaoysa-n
 
* molecular-weight:
 
* molecular-weight:
** 997.797
+
** 129.158
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-37]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10703]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=opc4-3-ketoacyl-coa}}
+
{{#set: common-name=4-acetamidobutanal}}
{{#set: inchi-key=inchikey=qgjlcxxjefrwhp-bumuvwnnsa-j}}
+
{{#set: inchi-key=inchikey=ddslgzoyepkpsj-uhfffaoysa-n}}
{{#set: molecular-weight=997.797}}
+
{{#set: molecular-weight=129.158}}

Revision as of 13:39, 14 January 2021

Metabolite CPD-30

  • smiles:
    • cc(nccc[ch]=o)=o
  • common-name:
    • 4-acetamidobutanal
  • inchi-key:
    • ddslgzoyepkpsj-uhfffaoysa-n
  • molecular-weight:
    • 129.158

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality