Difference between revisions of "GLY-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-5165 == * common-name: ** a (mannosyl)6-(n-acetylglucosaminyl)2-diphosphodolichol == Reaction(s) known to consume the compound == * [...") |
(Created page with "Category:metabolite == Metabolite N-5-PHOSPHORIBOSYL-ANTHRANILATE == * smiles: ** c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)nc2(c=cc=cc(c(=o)[o-])=2)) * common-name: ** n-(5-phos...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite N-5-PHOSPHORIBOSYL-ANTHRANILATE == |
| + | * smiles: | ||
| + | ** c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)nc2(c=cc=cc(c(=o)[o-])=2)) | ||
* common-name: | * common-name: | ||
| − | ** | + | ** n-(5-phosphoribosyl)-anthranilate |
| + | * inchi-key: | ||
| + | ** pmfmjxprnjuymb-gwofurmssa-k | ||
| + | * molecular-weight: | ||
| + | ** 346.21 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[PRAISOM-RXN]] |
| + | * [[PRTRANS-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN | + | * [[PRTRANS-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=n-(5-phosphoribosyl)-anthranilate}} |
| + | {{#set: inchi-key=inchikey=pmfmjxprnjuymb-gwofurmssa-k}} | ||
| + | {{#set: molecular-weight=346.21}} | ||
Revision as of 13:43, 14 January 2021
Contents
Metabolite N-5-PHOSPHORIBOSYL-ANTHRANILATE
- smiles:
- c(op(=o)([o-])[o-])c1(c(o)c(o)c(o1)nc2(c=cc=cc(c(=o)[o-])=2))
- common-name:
- n-(5-phosphoribosyl)-anthranilate
- inchi-key:
- pmfmjxprnjuymb-gwofurmssa-k
- molecular-weight:
- 346.21
