Difference between revisions of "TRNA-Sec"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-24183 == == Reaction(s) known to consume the compound == * RXN-22205 == Reaction(s) known to produce the compound == * RXN-222...") |
(Created page with "Category:metabolite == Metabolite CPD-7214 == * smiles: ** c3(c(c2(oc1(c=c(c=c(c=1c(c2)=o)o)[o-])))=cc(=c(c=3o)o)o) * common-name: ** (2s)-dihydrotricetin * inchi-key: **...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-7214 == |
+ | * smiles: | ||
+ | ** c3(c(c2(oc1(c=c(c=c(c=1c(c2)=o)o)[o-])))=cc(=c(c=3o)o)o) | ||
+ | * common-name: | ||
+ | ** (2s)-dihydrotricetin | ||
+ | * inchi-key: | ||
+ | ** usqxpewrywrrjd-lbprgkrzsa-m | ||
+ | * molecular-weight: | ||
+ | ** 303.248 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[RXN-7922]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | {{#set: common-name=(2s)-dihydrotricetin}} | ||
+ | {{#set: inchi-key=inchikey=usqxpewrywrrjd-lbprgkrzsa-m}} | ||
+ | {{#set: molecular-weight=303.248}} |
Revision as of 09:04, 15 March 2021
Contents
Metabolite CPD-7214
- smiles:
- c3(c(c2(oc1(c=c(c=c(c=1c(c2)=o)o)[o-])))=cc(=c(c=3o)o)o)
- common-name:
- (2s)-dihydrotricetin
- inchi-key:
- usqxpewrywrrjd-lbprgkrzsa-m
- molecular-weight:
- 303.248