Difference between revisions of "Annotation"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite D-MYO-INOSITOL-4-PHOSPHATE == * smiles: ** c1(o)(c(o)c(o)c(op(=o)([o-])[o-])c(o)c(o)1) * common-name: ** 1d-myo-inositol 4-monophosphate...") |
(Created page with "Category:metabolite == Metabolite CPD-4702 == * smiles: ** cc(c)=cccc(c)[ch]3(cc[ch]4(c2(cc[ch]1(c(c([o-])=o)c(o)ccc(c)1c=2ccc(c)34)))) * common-name: ** 4α-carboxy-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-4702 == |
* smiles: | * smiles: | ||
| − | ** | + | ** cc(c)=cccc(c)[ch]3(cc[ch]4(c2(cc[ch]1(c(c([o-])=o)c(o)ccc(c)1c=2ccc(c)34)))) |
* common-name: | * common-name: | ||
| − | ** | + | ** 4α-carboxy-5α-cholesta-8,24-dien-3β-ol |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** jhiwifrqjxlneu-gsqagghasa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 427.646 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN66-318]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-13709]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=4α-carboxy-5α-cholesta-8,24-dien-3β-ol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=jhiwifrqjxlneu-gsqagghasa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=427.646}} |
Revision as of 09:08, 15 March 2021
Contents
Metabolite CPD-4702
- smiles:
- cc(c)=cccc(c)[ch]3(cc[ch]4(c2(cc[ch]1(c(c([o-])=o)c(o)ccc(c)1c=2ccc(c)34))))
- common-name:
- 4α-carboxy-5α-cholesta-8,24-dien-3β-ol
- inchi-key:
- jhiwifrqjxlneu-gsqagghasa-m
- molecular-weight:
- 427.646
