Difference between revisions of "DNA-Adjacent-Pyrimidines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CIS-ACONITATE == * smiles: ** c([o-])(=o)c(=cc(=o)[o-])cc(=o)[o-] * common-name: ** cis-aconitate * inchi-key: ** gtzcvfvgugfeme-iwqzzhsr...") |
(Created page with "Category:metabolite == Metabolite Holo-LYS2-peptidyl-carrier-protein == * common-name: ** a holo-[lys2 peptidyl-carrier-protein] == Reaction(s) known to consume the compou...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Holo-LYS2-peptidyl-carrier-protein == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** a holo-[lys2 peptidyl-carrier-protein] |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-16759]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-16759]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a holo-[lys2 peptidyl-carrier-protein]}} |
| − | |||
| − | |||
Revision as of 20:22, 17 March 2021
Contents
Metabolite Holo-LYS2-peptidyl-carrier-protein
- common-name:
- a holo-[lys2 peptidyl-carrier-protein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a holo-[lys2 peptidyl-carrier-protein" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
