Difference between revisions of "TRNA-Sec"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7214 == * smiles: ** c3(c(c2(oc1(c=c(c=c(c=1c(c2)=o)o)[o-])))=cc(=c(c=3o)o)o) * common-name: ** (2s)-dihydrotricetin * inchi-key: **...") |
(Created page with "Category:metabolite == Metabolite 2-4-2-N-linked-Glycan == * common-name: ** [(2),(4),(2)]-n-linked glycan == Reaction(s) known to consume the compound == == Reaction(s) k...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 2-4-2-N-linked-Glycan == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** ( | + | ** [(2),(4),(2)]-n-linked glycan |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[2.4.1.144-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=( | + | {{#set: common-name=[(2),(4),(2)]-n-linked glycan}} |
| − | |||
| − | |||
Revision as of 20:24, 17 March 2021
Contents
Metabolite 2-4-2-N-linked-Glycan
- common-name:
- [(2),(4),(2)]-n-linked glycan
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "(2),(4),(2)]-n-linked glycan" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
