Difference between revisions of "T2-C4-DECADIENYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12483 == * smiles: ** cn1(c(=o)nc2(=c1c(=o)n(c)c(=o)n2)) * common-name: ** 1,7-dimethylurate * inchi-key: ** nofnclgcujjpku-uhfffaoys...") |
(Created page with "Category:metabolite == Metabolite 3-hydroxy-cis-D9-hexaecenoyl-ACPs == * common-name: ** a (3r)-3-hydroxy cis δ9-hexadecenoyl-[acp] == Reaction(s) known to consume t...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 3-hydroxy-cis-D9-hexaecenoyl-ACPs == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** a (3r)-3-hydroxy cis δ9-hexadecenoyl-[acp] |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-10660]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-10659]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a (3r)-3-hydroxy cis δ9-hexadecenoyl-[acp]}} |
| − | |||
| − | |||
Revision as of 20:25, 17 March 2021
Contents
Metabolite 3-hydroxy-cis-D9-hexaecenoyl-ACPs
- common-name:
- a (3r)-3-hydroxy cis δ9-hexadecenoyl-[acp]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
Property "Common-name" (as page type) with input value "a (3r)-3-hydroxy cis δ9-hexadecenoyl-[acp" contains invalid characters or is incomplete and therefore can cause unexpected results during a query or annotation process.
