Difference between revisions of "DNA-N"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD1F-97 == * smiles: ** c=c1(c2(cc3(c1)(c([ch]4(c(c)(cccc(co)([ch](cc2)3)4)c([o-])=o))c([o-])=o))) * common-name: ** gibberellin a15 (op...")
(Created page with "Category:metabolite == Metabolite L-ORNITHINE == * smiles: ** c(c[n+])cc([n+])c([o-])=o * common-name: ** l-ornithine * inchi-key: ** ahlphdhhmvztml-bypyzucnsa-o * molecul...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD1F-97 ==
+
== Metabolite L-ORNITHINE ==
 
* smiles:
 
* smiles:
** c=c1(c2(cc3(c1)(c([ch]4(c(c)(cccc(co)([ch](cc2)3)4)c([o-])=o))c([o-])=o)))
+
** c(c[n+])cc([n+])c([o-])=o
 
* common-name:
 
* common-name:
** gibberellin a15 (open lactone form)
+
** l-ornithine
 
* inchi-key:
 
* inchi-key:
** tzgxvfytktwkcu-cxxojbqzsa-l
+
** ahlphdhhmvztml-bypyzucnsa-o
 
* molecular-weight:
 
* molecular-weight:
** 346.422
+
** 133.17
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN1F-163]]
+
* [[ACETYLORNDEACET-RXN]]
 +
* [[ARGINASE-RXN]]
 +
* [[ORNCARBAMTRANSFER-RXN]]
 +
* [[ORNDECARBOX-RXN]]
 +
* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
 +
* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN-L-ORNITHINE/P-HYDROXY-PHENYLPYRUVATE//TYR/L-GLUTAMATE_GAMMA-SEMIALDEHYDE.73.]]
 +
* [[ORNITHINE-CYCLODEAMINASE-RXN]]
 +
* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
 +
* [[RXN-13482]]
 +
* [[biomass_rxn]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN1F-162]]
+
* [[ACETYLORNDEACET-RXN]]
 +
* [[ARGINASE-RXN]]
 +
* [[GLUTAMATE-N-ACETYLTRANSFERASE-RXN]]
 +
* [[ORNCARBAMTRANSFER-RXN]]
 +
* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN]]
 +
* [[ORNITHINE--OXO-ACID-AMINOTRANSFERASE-RXN-L-ORNITHINE/P-HYDROXY-PHENYLPYRUVATE//TYR/L-GLUTAMATE_GAMMA-SEMIALDEHYDE.73.]]
 +
* [[ORNITHINE-GLU-AMINOTRANSFERASE-RXN]]
 +
* [[RXN-13482]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=gibberellin a15 (open lactone form)}}
+
{{#set: common-name=l-ornithine}}
{{#set: inchi-key=inchikey=tzgxvfytktwkcu-cxxojbqzsa-l}}
+
{{#set: inchi-key=inchikey=ahlphdhhmvztml-bypyzucnsa-o}}
{{#set: molecular-weight=346.422}}
+
{{#set: molecular-weight=133.17}}

Revision as of 20:25, 17 March 2021