Difference between revisions of "GLY-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD1F-115 == * smiles: ** cc(=cccc(=cc=cc(=cc=cc(=cc=cc=c(c=cc=c(c=cc1(c(ccc=c1c)(c)c))c)c)c)c)c)c * common-name: ** δ-carotene * i...")
(Created page with "Category:metabolite == Metabolite DITP == * smiles: ** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23))) * common-name: ** ditp * inchi-key...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD1F-115 ==
+
== Metabolite DITP ==
 
* smiles:
 
* smiles:
** cc(=cccc(=cc=cc(=cc=cc(=cc=cc=c(c=cc=c(c=cc1(c(ccc=c1c)(c)c))c)c)c)c)c)c
+
** c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23)))
 
* common-name:
 
* common-name:
** δ-carotene
+
** ditp
 
* inchi-key:
 
* inchi-key:
** wgiygodpclmgqh-goxcnptksa-n
+
** ufjpaqslhagebl-rrkcrqdmsa-j
 
* molecular-weight:
 
* molecular-weight:
** 536.882
+
** 488.137
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-8028]]
+
* [[RXN-14228]]
* [[RXN1F-147]]
+
* [[RXN0-1602]]
* [[RXN1F-148]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN1F-147]]
+
* [[RXN-14228]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=δ-carotene}}
+
{{#set: common-name=ditp}}
{{#set: inchi-key=inchikey=wgiygodpclmgqh-goxcnptksa-n}}
+
{{#set: inchi-key=inchikey=ufjpaqslhagebl-rrkcrqdmsa-j}}
{{#set: molecular-weight=536.882}}
+
{{#set: molecular-weight=488.137}}

Revision as of 20:25, 17 March 2021

Metabolite DITP

  • smiles:
    • c(op(=o)([o-])op(=o)([o-])op(=o)([o-])[o-])c1(oc(cc(o)1)n3(c=nc2(c(=o)nc=nc=23)))
  • common-name:
    • ditp
  • inchi-key:
    • ufjpaqslhagebl-rrkcrqdmsa-j
  • molecular-weight:
    • 488.137

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality