Difference between revisions of "Thiols"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CREATINE == * smiles: ** c(c(=o)[o-])n(c)c(n)=[n+] * common-name: ** creatine * inchi-key: ** cvsvtcorwbxhqv-uhfffaoysa-n * molecular-wei...") |
(Created page with "Category:metabolite == Metabolite Thiols == * common-name: ** a thiol == Reaction(s) known to consume the compound == * RXN-16226 == Reaction(s) known to produce the c...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite Thiols == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** a thiol |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN-16226]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=a thiol}} |
| − | |||
| − | |||
Latest revision as of 08:55, 18 March 2021
Contents
Metabolite Thiols
- common-name:
- a thiol
