Difference between revisions of "DNA-Adjacent-Pyrimidines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite THREO-DS-ISO-CITRATE == * smiles: ** c(=o)(c(cc([o-])=o)c(o)c([o-])=o)[o-] * common-name: ** d-threo-isocitrate * inchi-key: ** odblhexud...") |
(Created page with "Category:metabolite == Metabolite DNA-Adjacent-Pyrimidines == == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound == * DEOXYRIBO...") |
||
| (6 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DNA-Adjacent-Pyrimidines == |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[DEOXYRIBODIPYRIMIDINE-PHOTOLYASE-RXN]] |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
| − | |||
