Difference between revisions of "DNA-Adjacent-Pyrimidines"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-13187 == * smiles: ** cc2(oc(oc1(c(o)c(o)oc(co)c(o)1))c(o)c(o)c2oc3(oc(co)c(c(o)c(o)3)oc4(oc(c([o-])=o)=cc(o)c(o)4))) * common-name:...") |
(Created page with "Category:metabolite == Metabolite DNA-Adjacent-Pyrimidines == == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound == * DEOXYRIBO...") |
||
| (10 intermediate revisions by 3 users not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DNA-Adjacent-Pyrimidines == |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[DEOXYRIBODIPYRIMIDINE-PHOTOLYASE-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
| − | |||
