Difference between revisions of "ALLO-THR"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11528 == * smiles: ** ccc=ccc4(c(=o)ccc(cc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2...")
(Created page with "Category:metabolite == Metabolite ALLO-THR == * common-name: ** dl-allothreonine == Reaction(s) known to consume the compound == * RXN0-5234 == Reaction(s) known to pr...")
 
(3 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11528 ==
+
== Metabolite ALLO-THR ==
* smiles:
 
** ccc=ccc4(c(=o)ccc(cc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])4)
 
 
* common-name:
 
* common-name:
** opc4-3-ketoacyl-coa
+
** dl-allothreonine
* inchi-key:
 
** qgjlcxxjefrwhp-bumuvwnnsa-j
 
* molecular-weight:
 
** 997.797
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN0-5234]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10703]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=opc4-3-ketoacyl-coa}}
+
{{#set: common-name=dl-allothreonine}}
{{#set: inchi-key=inchikey=qgjlcxxjefrwhp-bumuvwnnsa-j}}
 
{{#set: molecular-weight=997.797}}
 

Latest revision as of 08:56, 18 March 2021

Metabolite ALLO-THR

  • common-name:
    • dl-allothreonine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality