Difference between revisions of "CPD-458"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-12724 == * smiles: ** c1(c=cc(=cc=1)c2(=cc(=o)c3(=c(o2)c=c(o)c(o)=c(o)3))) * common-name: ** baicalein * inchi-key: ** fxnfhkrtjbstcs...") |
(Created page with "Category:metabolite == Metabolite CPD-458 == * smiles: ** c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(c2o)o)o)o)o)))o * common-name: ** galactinol * inchi-key: ** vcwmrqdbpzkxkg-xidcd...") |
||
(10 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite CPD- | + | == Metabolite CPD-458 == |
* smiles: | * smiles: | ||
− | ** c1(c | + | ** c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(c2o)o)o)o)o)))o |
* common-name: | * common-name: | ||
− | ** | + | ** galactinol |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** vcwmrqdbpzkxkg-xidcdeprsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 342.299 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN- | + | * [[2.4.1.67-RXN]] |
+ | * [[RXN-8281]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[2.4.1.67-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=galactinol}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vcwmrqdbpzkxkg-xidcdeprsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=342.299}} |
Latest revision as of 08:57, 18 March 2021
Contents
Metabolite CPD-458
- smiles:
- c(c1(oc(c(c(c1o)o)o)oc2(c(c(c(c(c2o)o)o)o)o)))o
- common-name:
- galactinol
- inchi-key:
- vcwmrqdbpzkxkg-xidcdeprsa-n
- molecular-weight:
- 342.299