Difference between revisions of "Cellodextrins"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite UNDECAPRENYL-DIPHOSPHATE == * smiles: ** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op...")
(Created page with "Category:metabolite == Metabolite Cellodextrins == * common-name: ** a cellodextrin == Reaction(s) known to consume the compound == == Reaction(s) known to produce the com...")
 
(2 intermediate revisions by 2 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite UNDECAPRENYL-DIPHOSPHATE ==
+
== Metabolite Cellodextrins ==
* smiles:
 
** cc(=cccc(=cccc(=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=cccc(c)=ccop([o-])(=o)op(=o)([o-])[o-])c)c)c
 
 
* common-name:
 
* common-name:
** di-trans,octa-cis-undecaprenyl diphosphate
+
** a cellodextrin
* inchi-key:
 
** ntxgvhccxvhycl-ntdveaecsa-k
 
* molecular-weight:
 
** 924.251
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8999]]
+
* [[RXN-2043]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=di-trans,octa-cis-undecaprenyl diphosphate}}
+
{{#set: common-name=a cellodextrin}}
{{#set: inchi-key=inchikey=ntxgvhccxvhycl-ntdveaecsa-k}}
 
{{#set: molecular-weight=924.251}}
 

Latest revision as of 08:58, 18 March 2021

Metabolite Cellodextrins

  • common-name:
    • a cellodextrin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality