Difference between revisions of "HX"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD-7109 == * smiles: ** cc(=ccc1(=c(c=c(c(=c1o)c(cc(c)c)=o)o)[o-]))c * common-name: ** 4-prenylphlorisovalerophenone * inchi-key: ** lwl...") |
(Created page with "Category:metabolite == Metabolite HX == * smiles: ** [xh] * common-name: ** hx == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound...") |
||
(9 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite HX == |
* smiles: | * smiles: | ||
− | ** | + | ** [xh] |
* common-name: | * common-name: | ||
− | ** | + | ** hx |
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[GSHTRAN-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=hx}} |
− | |||
− |
Latest revision as of 08:59, 18 March 2021
Contents
Metabolite HX
- smiles:
- [xh]
- common-name:
- hx