Difference between revisions of "HX"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite 5-P-BETA-D-RIBOSYL-AMINE == * smiles: ** c(op([o-])(=o)[o-])c1(c(o)c(o)c([n+])o1) * common-name: ** 5-phospho-β-d-ribosylamine * inc...") |
(Created page with "Category:metabolite == Metabolite HX == * smiles: ** [xh] * common-name: ** hx == Reaction(s) known to consume the compound == == Reaction(s) known to produce the compound...") |
||
| (One intermediate revision by one other user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite HX == |
* smiles: | * smiles: | ||
| − | ** | + | ** [xh] |
* common-name: | * common-name: | ||
| − | ** | + | ** hx |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[GSHTRAN-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=hx}} |
| − | |||
| − | |||
Latest revision as of 08:59, 18 March 2021
Contents
Metabolite HX
- smiles:
- [xh]
- common-name:
- hx
