Difference between revisions of "T2-C4-DECADIENYL-COA"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 3-hydroxy-cis-D9-hexaecenoyl-ACPs == * common-name: ** a (3r)-3-hydroxy cis δ9-hexadecenoyl-[acp] == Reaction(s) known to consume t...")
(Created page with "Category:metabolite == Metabolite T2-C4-DECADIENYL-COA == * smiles: ** cccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c...")
 
(7 intermediate revisions by 3 users not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 3-hydroxy-cis-D9-hexaecenoyl-ACPs ==
+
== Metabolite T2-C4-DECADIENYL-COA ==
 +
* smiles:
 +
** cccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
 
* common-name:
 
* common-name:
** a (3r)-3-hydroxy cis δ9-hexadecenoyl-[acp]
+
** trans-δ2, cis-δ4-decadienoyl-coa
 +
* inchi-key:
 +
** fasakylwsrdqoh-imvfqkdnsa-j
 +
* molecular-weight:
 +
** 913.722
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-10660]]
+
* [[DIENOYLCOAREDUCT-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-10659]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=a (3r)-3-hydroxy cis δ9-hexadecenoyl-[acp]}}
+
{{#set: common-name=trans-δ2, cis-δ4-decadienoyl-coa}}
 +
{{#set: inchi-key=inchikey=fasakylwsrdqoh-imvfqkdnsa-j}}
 +
{{#set: molecular-weight=913.722}}

Latest revision as of 08:59, 18 March 2021

Metabolite T2-C4-DECADIENYL-COA

  • smiles:
    • cccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
  • common-name:
    • trans-δ2, cis-δ4-decadienoyl-coa
  • inchi-key:
    • fasakylwsrdqoh-imvfqkdnsa-j
  • molecular-weight:
    • 913.722

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality