Difference between revisions of "T2-C4-DECADIENYL-COA"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Ceramides == * common-name: ** a ceramide == Reaction(s) known to consume the compound == * RXN-11375 == Reaction(s) known to produce...") |
(Created page with "Category:metabolite == Metabolite T2-C4-DECADIENYL-COA == * smiles: ** cccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c...") |
||
(5 intermediate revisions by 3 users not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite T2-C4-DECADIENYL-COA == |
+ | * smiles: | ||
+ | ** cccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-] | ||
* common-name: | * common-name: | ||
− | ** | + | ** trans-δ2, cis-δ4-decadienoyl-coa |
+ | * inchi-key: | ||
+ | ** fasakylwsrdqoh-imvfqkdnsa-j | ||
+ | * molecular-weight: | ||
+ | ** 913.722 | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[RXN | + | * [[DIENOYLCOAREDUCT-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=trans-δ2, cis-δ4-decadienoyl-coa}} |
+ | {{#set: inchi-key=inchikey=fasakylwsrdqoh-imvfqkdnsa-j}} | ||
+ | {{#set: molecular-weight=913.722}} |
Latest revision as of 08:59, 18 March 2021
Contents
Metabolite T2-C4-DECADIENYL-COA
- smiles:
- cccccc=cc=cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
- common-name:
- trans-δ2, cis-δ4-decadienoyl-coa
- inchi-key:
- fasakylwsrdqoh-imvfqkdnsa-j
- molecular-weight:
- 913.722