Difference between revisions of "DNA-N"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-ORNITHINE == * smiles: ** c(c[n+])cc([n+])c([o-])=o * common-name: ** l-ornithine * inchi-key: ** ahlphdhhmvztml-bypyzucnsa-o * molecul...") |
(Created page with "Category:metabolite == Metabolite DNA-N == * common-name: ** dnan == Reaction(s) known to consume the compound == * DNA-DIRECTED-DNA-POLYMERASE-RXN * DNA-LIGASE-ATP-...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite DNA-N == |
| − | |||
| − | |||
* common-name: | * common-name: | ||
| − | ** | + | ** dnan |
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[DNA-DIRECTED-DNA-POLYMERASE-RXN]] |
| − | + | * [[DNA-LIGASE-ATP-RXN]] | |
| − | + | * [[RNA-DIRECTED-DNA-POLYMERASE-RXN]] | |
| − | + | * [[RXN0-4961]] | |
| − | |||
| − | * [[ | ||
| − | * [[ | ||
| − | |||
| − | * [[ | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[DNA-DIRECTED-DNA-POLYMERASE-RXN]] |
| − | + | * [[RNA-DIRECTED-DNA-POLYMERASE-RXN]] | |
| − | |||
| − | |||
| − | |||
| − | * [[ | ||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=dnan}} |
| − | |||
| − | |||
Latest revision as of 08:59, 18 March 2021
Contents
Metabolite DNA-N
- common-name:
- dnan
