Difference between revisions of "GLY-tRNAs"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite CPD1F-115 == * smiles: ** cc(=cccc(=cc=cc(=cc=cc(=cc=cc=c(c=cc=c(c=cc1(c(ccc=c1c)(c)c))c)c)c)c)c)c * common-name: ** δ-carotene * i...") |
(Created page with "Category:metabolite == Metabolite GLY-tRNAs == * common-name: ** a trnagly == Reaction(s) known to consume the compound == * GLYCINE--TRNA-LIGASE-RXN == Reaction(s) kn...") |
||
(One intermediate revision by one other user not shown) | |||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite GLY-tRNAs == |
− | |||
− | |||
* common-name: | * common-name: | ||
− | ** | + | ** a trnagly |
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[GLYCINE--TRNA-LIGASE-RXN]] |
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=a trnagly}} |
− | |||
− |
Latest revision as of 08:59, 18 March 2021
Contents
Metabolite GLY-tRNAs
- common-name:
- a trnagly