Difference between revisions of "PRO-tRNAs"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-18489 == * smiles: ** cccccc=ccc=ccc=ccc=ccccccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(...")
(Created page with "Category:metabolite == Metabolite PRO-tRNAs == * common-name: ** a trnapro == Reaction(s) known to consume the compound == * PROLINE--TRNA-LIGASE-RXN == Reaction(s) kn...")
 
(One intermediate revision by one other user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-18489 ==
+
== Metabolite PRO-tRNAs ==
* smiles:
 
** cccccc=ccc=ccc=ccc=ccccccc(o)cc(sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-])=o
 
 
* common-name:
 
* common-name:
** (3r)-hydroxy-tetracosatetraenoyl-coa
+
** a trnapro
* inchi-key:
 
** dmysjgjjptxmaw-jjkiljmssa-j
 
* molecular-weight:
 
** 1122.065
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-17110]]
+
* [[PROLINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-17109]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=(3r)-hydroxy-tetracosatetraenoyl-coa}}
+
{{#set: common-name=a trnapro}}
{{#set: inchi-key=inchikey=dmysjgjjptxmaw-jjkiljmssa-j}}
 
{{#set: molecular-weight=1122.065}}
 

Latest revision as of 09:00, 18 March 2021

Metabolite PRO-tRNAs

  • common-name:
    • a trnapro

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality