Difference between revisions of "Manual"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-CITRULLINE == * smiles: ** c(nc(n)=o)ccc([n+])c(=o)[o-] * common-name: ** l-citrulline * inchi-key: ** rhgklrlohdjjdr-bypyzucnsa-n * mo...") |
(Created page with "Category:metabolite == Metabolite COUMARALDEHYDE == * smiles: ** c(=o)c=cc1(c=cc(o)=cc=1) * common-name: ** 4-coumaraldehyde * inchi-key: ** cjxmvkynvigqbs-owojbtedsa-n *...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite COUMARALDEHYDE == |
* smiles: | * smiles: | ||
− | ** c( | + | ** c(=o)c=cc1(c=cc(o)=cc=1) |
* common-name: | * common-name: | ||
− | ** | + | ** 4-coumaraldehyde |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** cjxmvkynvigqbs-owojbtedsa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 148.161 |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | + | * [[RXN-1102]] | |
− | |||
− | * [[RXN- | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | + | * [[RXN-1101]] | |
− | * [[RXN- | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name= | + | {{#set: common-name=4-coumaraldehyde}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=cjxmvkynvigqbs-owojbtedsa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=148.161}} |
Revision as of 16:56, 13 January 2021
Contents
Metabolite COUMARALDEHYDE
- smiles:
- c(=o)c=cc1(c=cc(o)=cc=1)
- common-name:
- 4-coumaraldehyde
- inchi-key:
- cjxmvkynvigqbs-owojbtedsa-n
- molecular-weight:
- 148.161