Difference between revisions of "NADP"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD0-2123 == * common-name: ** 3-oxodecanoyl-coa * molecular-weight: ** 931.738 * inchi-key: ** azcvxmaplhsiky-hsjnekgzsa-j * smiles: **...")
(Created page with "Category:metabolite == Metabolite NADP == * common-name: ** nadp+ * molecular-weight: ** 740.386 * inchi-key: ** xjlxinkubywoni-nnyoxohssa-k * smiles: ** c5(=[n+](c1(oc(c(...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
−
== Metabolite CPD0-2123 ==
+
== Metabolite NADP ==
 
* common-name:
 
* common-name:
−
** 3-oxodecanoyl-coa
+
** nadp+
 
* molecular-weight:
 
* molecular-weight:
−
** 931.738
+
** 740.386
 
* inchi-key:
 
* inchi-key:
−
** azcvxmaplhsiky-hsjnekgzsa-j
+
** xjlxinkubywoni-nnyoxohssa-k
 
* smiles:
 
* smiles:
−
** cccccccc(=o)cc(=o)sccnc(=o)ccnc(=o)c(o)c(c)(c)cop(=o)(op(=o)(occ1(c(op([o-])(=o)[o-])c(o)c(o1)n3(c2(=c(c(n)=nc=n2)n=c3))))[o-])[o-]
+
** c5(=[n+](c1(oc(c(c1o)o)cop(op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)op([o-])([o-])=o)o))([o-])=o)(=o)[o-]))c=c(c=c5)c(=o)n)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RXN-13617]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[1.1.1.34-RXN]]
 +
* [[1.18.1.2-RXN]]
 +
* [[1.2.1.18-RXN]]
 +
* [[1.2.1.9-RXN]]
 +
* [[ALDEHYDE-DEHYDROGENASE-NADP+-RXN]]
 +
* [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]]
 +
* [[CARBONYL-REDUCTASE-NADPH-RXN]]
 +
* [[DTDPDEHYRHAMREDUCT-RXN]]
 +
* [[ENZRXN-201-RXN]]
 +
* [[ExchangeSeed-NADP]]
 +
* [[GLU6PDEHYDROG-RXN]]
 +
* [[GLUTDEHYD-RXN]]
 +
* [[ISOCITDEH-RXN]]
 +
* [[L-XYLULOSE-REDUCTASE-RXN]]
 +
* [[MALIC-NADP-RXN]]
 +
* [[METHYLENETHFDEHYDROG-NADP-RXN]]
 +
* [[N-ACETYLGLUTPREDUCT-RXN]]
 +
* [[NADPH-DEHYDROGENASE-RXN]]
 +
* [[PREPHENATE-DEHYDROGENASE-NADP+-RXN]]
 +
* [[PYRIDOXINE-4-DEHYDROGENASE-RXN]]
 +
* [[RXN-10841]]
 +
* [[RXN-1124]]
 +
* [[RXN-12560]]
 +
* [[RXN-12747]]
 +
* [[RXN-13279]]
 +
* [[RXN-14209]]
 +
* [[RXN-5822]]
 +
* [[RXN-701]]
 +
* [[RXN-8349_PLANTCYC]]
 +
* [[RXN-8772]]
 +
* [[RXN-8773]]
 +
* [[RXN-924]]
 +
* [[RXN-9951]]
 +
* [[RXN-9952]]
 +
* [[RXN0-3962]]
 +
* [[RXN1F-72]]
 +
* [[SUCCSEMIALDDEHYDROG-RXN]]
 +
* [[TransportSeed-NADP]]
 +
</div>
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-12490]]
+
<div class="toccolours mw-collapsible mw-collapsed" style="width:100%; overflow:auto;">
 +
* [[1.1.1.271-RXN]]
 +
* [[1.1.1.34-RXN]]
 +
* [[1.14.13.8-RXN]]
 +
* [[1.18.1.2-RXN]]
 +
* [[1.2.1.13-RXN]]
 +
* [[1.2.1.18-RXN]]
 +
* [[12-OXOPHYTODIENOATE-REDUCTASE-RXN]]
 +
* [[2.1.1.135-RXN]]
 +
* [[3-HYDROXYBUTYRYL-COA-DEHYDROGENASE-RXN]]
 +
* [[3-OXOACYL-ACP-REDUCT-RXN]]
 +
* [[ACETOLACTREDUCTOISOM-RXN]]
 +
* [[ACETOOHBUTREDUCTOISOM-RXN]]
 +
* [[ALCOHOL-DEHYDROGENASE-NADPORNOP+-RXN]]
 +
* [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]]
 +
* [[CARBONYL-REDUCTASE-NADPH-RXN]]
 +
* [[DIENOYLCOAREDUCT-RXN]]
 +
* [[DIHYDROFOLATEREDUCT-RXN]]
 +
* [[DIHYDROFOLATEREDUCT-RXN-THF/NADP//DIHYDROFOLATE/NADPH/PROTON.37.]]
 +
* [[DIHYDROKAEMPFEROL-4-REDUCTASE-RXN]]
 +
* [[DTDPDEHYRHAMREDUCT-RXN]]
 +
* [[ENOYL-ACP-REDUCT-NADPH-RXN]]
 +
* [[ENZRXN-201-RXN]]
 +
* [[ExchangeSeed-NADP]]
 +
* [[FATTY-ACID-SYNTHASE-RXN]]
 +
* [[FLAVONADPREDUCT-RXN]]
 +
* [[GLUTAMATESYN-RXN]]
 +
* [[GLUTATHIONE-REDUCT-NADPH-RXN]]
 +
* [[GLUTDEHYD-RXN]]
 +
* [[GLUTRNAREDUCT-RXN]]
 +
* [[GLUTSEMIALDEHYDROG-RXN]]
 +
* [[GLYOXYLATE-REDUCTASE-NADP+-RXN]]
 +
* [[ISOCITDEH-RXN]]
 +
* [[L-XYLULOSE-REDUCTASE-RXN]]
 +
* [[LONG-CHAIN-FATTY-ACYL-COA-REDUCTASE-RXN]]
 +
* [[METHYLENETHFDEHYDROG-NADP-RXN]]
 +
* [[N-ACETYLGLUTPREDUCT-RXN]]
 +
* [[NAD-KIN-RXN]]
 +
* [[NADPH--FERRIHEMOPROTEIN-REDUCTASE-RXN]]
 +
* [[NADPH-DEHYDROGENASE-FLAVIN-RXN]]
 +
* [[NADPH-DEHYDROGENASE-RXN]]
 +
* [[NITRATE-REDUCTASE-NADPH-RXN]]
 +
* [[PYRIDOXINE-4-DEHYDROGENASE-RXN]]
 +
* [[PYRNUTRANSHYDROGEN-RXN]]
 +
* [[RIBOFLAVINSYNREDUC-RXN]]
 +
* [[RXN-10060]]
 +
* [[RXN-10625]]
 +
* [[RXN-10655]]
 +
* [[RXN-10659]]
 +
* [[RXN-10717]]
 +
* [[RXN-10841]]
 +
* [[RXN-1101]]
 +
* [[RXN-1102]]
 +
* [[RXN-1106]]
 +
* [[RXN-1124]]
 +
* [[RXN-1125]]
 +
* [[RXN-11476]]
 +
* [[RXN-11480]]
 +
* [[RXN-11878]]
 +
* [[RXN-12484]]
 +
* [[RXN-12521]]
 +
* [[RXN-12747]]
 +
* [[RXN-13008]]
 +
* [[RXN-13279]]
 +
* [[RXN-13299]]
 +
* [[RXN-13307]]
 +
* [[RXN-13398]]
 +
* [[RXN-13431]]
 +
* [[RXN-13685]]
 +
* [[RXN-13724]]
 +
* [[RXN-14014]]
 +
* [[RXN-14023]]
 +
* [[RXN-14209]]
 +
* [[RXN-14715]]
 +
* [[RXN-14776]]
 +
* [[RXN-14790]]
 +
* [[RXN-14972]]
 +
* [[RXN-14973]]
 +
* [[RXN-15006]]
 +
* [[RXN-15046]]
 +
* [[RXN-16016]]
 +
* [[RXN-16095]]
 +
* [[RXN-16097]]
 +
* [[RXN-16112]]
 +
* [[RXN-16129]]
 +
* [[RXN-16131]]
 +
* [[RXN-16154]]
 +
* [[RXN-16616]]
 +
* [[RXN-16622]]
 +
* [[RXN-16626]]
 +
* [[RXN-16630]]
 +
* [[RXN-17107]]
 +
* [[RXN-17109]]
 +
* [[RXN-21831]]
 +
* [[RXN-2221]]
 +
* [[RXN-3142]]
 +
* [[RXN-4144]]
 +
* [[RXN-5285]]
 +
* [[RXN-5482]]
 +
* [[RXN-5901]]
 +
* [[RXN-600]]
 +
* [[RXN-701]]
 +
* [[RXN-707]]
 +
* [[RXN-711]]
 +
* [[RXN-7676]]
 +
* [[RXN-7677]]
 +
* [[RXN-7698]]
 +
* [[RXN-7711]]
 +
* [[RXN-7784]]
 +
* [[RXN-7835]]
 +
* [[RXN-7911]]
 +
* [[RXN-8349_PLANTCYC]]
 +
* [[RXN-8772]]
 +
* [[RXN-8773]]
 +
* [[RXN-9514]]
 +
* [[RXN-9515]]
 +
* [[RXN-9518]]
 +
* [[RXN-9521]]
 +
* [[RXN-9524]]
 +
* [[RXN-9526]]
 +
* [[RXN-9528]]
 +
* [[RXN-9530]]
 +
* [[RXN-9532]]
 +
* [[RXN-9534]]
 +
* [[RXN-9536]]
 +
* [[RXN-9538]]
 +
* [[RXN-9540]]
 +
* [[RXN-9542]]
 +
* [[RXN-9544]]
 +
* [[RXN-9546]]
 +
* [[RXN-9552]]
 +
* [[RXN-9556]]
 +
* [[RXN-9633]]
 +
* [[RXN-9725]]
 +
* [[RXN-9951]]
 +
* [[RXN0-2142]]
 +
* [[RXN0-5101]]
 +
* [[RXN1F-10]]
 +
* [[RXN1F-72]]
 +
* [[RXN1G-1053]]
 +
* [[RXN1G-157]]
 +
* [[RXN1G-163]]
 +
* [[RXN1G-240]]
 +
* [[RXN1G-260]]
 +
* [[RXN1G-287]]
 +
* [[RXN1G-349]]
 +
* [[RXN1G-358]]
 +
* [[RXN1G-364]]
 +
* [[RXN1G-469]]
 +
* [[RXN1G-508]]
 +
* [[RXN1G-72]]
 +
* [[RXN1G-881]]
 +
* [[RXN3O-5293]]
 +
* [[RXN66-319]]
 +
* [[RXN66-482]]
 +
* [[RXN66-81]]
 +
* [[SHIKIMATE-5-DEHYDROGENASE-RXN]]
 +
* [[SULFITE-REDUCT-RXN]]
 +
* [[THIOREDOXIN-REDUCT-NADPH-RXN]]
 +
* [[TRANSENOYLCOARED-RXN]]
 +
* [[TransportSeed-NADP]]
 +
* [[UDPNACETYLMURAMATEDEHYDROG-RXN]]
 +
</div>
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
−
{{#set: common-name=3-oxodecanoyl-coa}}
+
{{#set: common-name=nadp+}}
−
{{#set: molecular-weight=931.738}}
+
{{#set: molecular-weight=740.386}}
−
{{#set: inchi-key=inchikey=azcvxmaplhsiky-hsjnekgzsa-j}}
+
{{#set: inchi-key=inchikey=xjlxinkubywoni-nnyoxohssa-k}}

Latest revision as of 19:35, 17 March 2021

Metabolite NADP

  • common-name:
    • nadp+
  • molecular-weight:
    • 740.386
  • inchi-key:
    • xjlxinkubywoni-nnyoxohssa-k
  • smiles:
    • c5(=[n+](c1(oc(c(c1o)o)cop(op(occ4(c(c(c(n3(c2(=c(c(=nc=n2)n)n=c3)))o4)op([o-])([o-])=o)o))([o-])=o)(=o)[o-]))c=c(c=c5)c(=o)n)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

Retrieved from "http://gem-aureme.genouest.org//esubgem/index.php?title=NADP&oldid=49408"