Difference between revisions of "2.6.1.70-RXN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite Dodecanoyl-ACPs == * common-name: ** a dodecanoyl-[acp] == Reaction(s) known to consume the compound == * LAUROYLACYLTRAN-RXN * RXN...") |
(Created page with "Category:metabolite == Metabolite CPD-12125 == * common-name: ** menaquinol-7 * inchi-key: ** vfgnpjrrtkmykn-ljwnyqgcsa-n * molecular-weight: ** 651.026 * smiles: ** cc(c)...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite CPD-12125 == |
* common-name: | * common-name: | ||
| − | ** | + | ** menaquinol-7 |
| + | * inchi-key: | ||
| + | ** vfgnpjrrtkmykn-ljwnyqgcsa-n | ||
| + | * molecular-weight: | ||
| + | ** 651.026 | ||
| + | * smiles: | ||
| + | ** cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/cc1(\c(/c)=c(c2(\c=cc=cc(/c(\o)=1)=2))/o) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[biomass]] |
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-9191]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=menaquinol-7}} |
| + | {{#set: inchi-key=inchikey=vfgnpjrrtkmykn-ljwnyqgcsa-n}} | ||
| + | {{#set: molecular-weight=651.026}} | ||
Revision as of 09:57, 27 August 2020
Contents
Metabolite CPD-12125
- common-name:
- menaquinol-7
- inchi-key:
- vfgnpjrrtkmykn-ljwnyqgcsa-n
- molecular-weight:
- 651.026
- smiles:
- cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/cc1(\c(/c)=c(c2(\c=cc=cc(/c(\o)=1)=2))/o)
