Difference between revisions of "ADENOSINE-NUCLEOSIDASE-RXN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite THMPT == * common-name: ** tetrahydromethanopterin * inchi-key: ** scbibgujsmhiai-lhiiqlezsa-k * molecular-weight: ** 773.666 * smiles: *...")
(Created page with "Category:metabolite == Metabolite ALL-TRANS-HEPTAPRENYL-DIPHOSPHATE == * common-name: ** all-trans-heptaprenyl diphosphate * inchi-key: ** lsjlexwxrktzaj-yuiipxgzsa-k * mo...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite THMPT ==
+
== Metabolite ALL-TRANS-HEPTAPRENYL-DIPHOSPHATE ==
 
* common-name:
 
* common-name:
** tetrahydromethanopterin
+
** all-trans-heptaprenyl diphosphate
 
* inchi-key:
 
* inchi-key:
** scbibgujsmhiai-lhiiqlezsa-k
+
** lsjlexwxrktzaj-yuiipxgzsa-k
 
* molecular-weight:
 
* molecular-weight:
** 773.666
+
** 651.779
 
* smiles:
 
* smiles:
** c[c@h]([c@@h]1([c@h](c)nc2(\n=c(nc(c(\n1)=2)=o)n)))nc4(/c=cc(\c[c@@h]([c@@h]([c@@h](co[c@h]3([c@@h]([c@@h]([c@@h](cop([o-])(=o)o[c@h](c([o-])=o)ccc([o-])=o)o3)o)o))o)o)o)=c/c=4)
+
** cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/cop(=o)([o-])op(=o)([o-])[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[RXN-9190]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15635]]
+
* [[RXN-11458]]
 +
* [[TRANS-HEXAPRENYLTRANSTRANSFERASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=tetrahydromethanopterin}}
+
{{#set: common-name=all-trans-heptaprenyl diphosphate}}
{{#set: inchi-key=inchikey=scbibgujsmhiai-lhiiqlezsa-k}}
+
{{#set: inchi-key=inchikey=lsjlexwxrktzaj-yuiipxgzsa-k}}
{{#set: molecular-weight=773.666}}
+
{{#set: molecular-weight=651.779}}

Revision as of 09:58, 27 August 2020

Metabolite ALL-TRANS-HEPTAPRENYL-DIPHOSPHATE

  • common-name:
    • all-trans-heptaprenyl diphosphate
  • inchi-key:
    • lsjlexwxrktzaj-yuiipxgzsa-k
  • molecular-weight:
    • 651.779
  • smiles:
    • cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/cop(=o)([o-])op(=o)([o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality