Difference between revisions of "ASPAMINOTRANS-RXN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ACP == * common-name: ** a soluble [acyl-carrier protein] == Reaction(s) known to consume the compound == * ACP-S-ACETYLTRANSFER-RXN...") |
(Created page with "Category:metabolite == Metabolite 7-CYANO-7-DEAZAGUANINE == * common-name: ** preq0 * inchi-key: ** fmksmydykxqyrv-uhfffaoysa-n * molecular-weight: ** 175.149 * smiles: **...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite 7-CYANO-7-DEAZAGUANINE == |
* common-name: | * common-name: | ||
| − | ** | + | ** preq0 |
| + | * inchi-key: | ||
| + | ** fmksmydykxqyrv-uhfffaoysa-n | ||
| + | * molecular-weight: | ||
| + | ** 175.149 | ||
| + | * smiles: | ||
| + | ** c12(=c(c(nc(=n1)n)=o)c(\c#n)=c/n2) | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[RXN0-4022]] |
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | + | * [[RXN-12093]] | |
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | * [[RXN- | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=preq0}} |
| + | {{#set: inchi-key=inchikey=fmksmydykxqyrv-uhfffaoysa-n}} | ||
| + | {{#set: molecular-weight=175.149}} | ||
Revision as of 10:00, 10 September 2020
Contents
Metabolite 7-CYANO-7-DEAZAGUANINE
- common-name:
- preq0
- inchi-key:
- fmksmydykxqyrv-uhfffaoysa-n
- molecular-weight:
- 175.149
- smiles:
- c12(=c(c(nc(=n1)n)=o)c(\c#n)=c/n2)
