Difference between revisions of "TransportSeed-ISOBUTYRATE"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite IMIDAZOLE-ACETOL-P == * common-name: ** imidazole acetol-phosphate * inchi-key: ** ycffmsolumramd-uhfffaoysa-l * molecular-weight: ** 218...")
(Created page with "Category:metabolite == Metabolite 3-KETOLACTOSE == * common-name: ** 3'-ketolactose * inchi-key: ** hkkhtabthsudbp-gihchdtpsa-n * molecular-weight: ** 340.283 * smiles: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite IMIDAZOLE-ACETOL-P ==
+
== Metabolite 3-KETOLACTOSE ==
 
* common-name:
 
* common-name:
** imidazole acetol-phosphate
+
** 3'-ketolactose
 
* inchi-key:
 
* inchi-key:
** ycffmsolumramd-uhfffaoysa-l
+
** hkkhtabthsudbp-gihchdtpsa-n
 
* molecular-weight:
 
* molecular-weight:
** 218.105
+
** 340.283
 
* smiles:
 
* smiles:
** c1(/nc=nc(\cc(cop([o-])(=o)[o-])=o)=1)
+
** c(o)[c@@h]2(o[c@@h](o[c@h]1([c@@h](co)o[c@h](o)[c@h](o)[c@@h](o)1))[c@h](o)c(=o)[c@@h](o)2)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[HISTAMINOTRANS-RXN]]
+
* [[KETOLACTOSE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[HISTAMINOTRANS-RXN]]
 
* [[IMIDPHOSDEHYD-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=imidazole acetol-phosphate}}
+
{{#set: common-name=3'-ketolactose}}
{{#set: inchi-key=inchikey=ycffmsolumramd-uhfffaoysa-l}}
+
{{#set: inchi-key=inchikey=hkkhtabthsudbp-gihchdtpsa-n}}
{{#set: molecular-weight=218.105}}
+
{{#set: molecular-weight=340.283}}

Revision as of 10:00, 10 September 2020

Metabolite 3-KETOLACTOSE

  • common-name:
    • 3'-ketolactose
  • inchi-key:
    • hkkhtabthsudbp-gihchdtpsa-n
  • molecular-weight:
    • 340.283
  • smiles:
    • c(o)[c@@h]2(o[c@@h](o[c@h]1([c@@h](co)o[c@h](o)[c@h](o)[c@@h](o)1))[c@h](o)c(=o)[c@@h](o)2)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality