Difference between revisions of "5-AMINOLEVULINIC-ACID-SYNTHASE-RXN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-11592 == * common-name: ** 2-methylsulfanyl-n6-dimethylallyladenosine37 in trna * smiles: ** cc(c)=ccnc2(c3(n=cn([c@h]1(o[c@h](cop(=o...")
(Created page with "Category:metabolite == Metabolite CPD-15301 == * common-name: ** caldariellaquinol * inchi-key: ** uvcqokdzgiahdg-uhfffaoysa-n * molecular-weight: ** 633.085 * smiles: **...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-11592 ==
+
== Metabolite CPD-15301 ==
 
* common-name:
 
* common-name:
** 2-methylsulfanyl-n6-dimethylallyladenosine37 in trna
+
** caldariellaquinol
 +
* inchi-key:
 +
** uvcqokdzgiahdg-uhfffaoysa-n
 +
* molecular-weight:
 +
** 633.085
 
* smiles:
 
* smiles:
** cc(c)=ccnc2(c3(n=cn([c@h]1(o[c@h](cop(=o)([o-])o[a trna])[c@@h](op([o-])(=o)o[a trna])[c@@h](o)1))c(n=c(sc)n=2)=3))
+
** cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc1(\c(/sc)=c(c2(/c=csc(/c(\o)=1)=2))/o)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14481]]
+
* [[RXN-15378]]
* [[RXN0-5063]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2-methylsulfanyl-n6-dimethylallyladenosine37 in trna}}
+
{{#set: common-name=caldariellaquinol}}
 +
{{#set: inchi-key=inchikey=uvcqokdzgiahdg-uhfffaoysa-n}}
 +
{{#set: molecular-weight=633.085}}

Revision as of 10:01, 10 September 2020

Metabolite CPD-15301

  • common-name:
    • caldariellaquinol
  • inchi-key:
    • uvcqokdzgiahdg-uhfffaoysa-n
  • molecular-weight:
    • 633.085
  • smiles:
    • cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc1(\c(/sc)=c(c2(/c=csc(/c(\o)=1)=2))/o)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality