Difference between revisions of "ADENOSINE-NUCLEOSIDASE-RXN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite ALL-TRANS-HEPTAPRENYL-DIPHOSPHATE == * common-name: ** all-trans-heptaprenyl diphosphate * inchi-key: ** lsjlexwxrktzaj-yuiipxgzsa-k * mo...") |
(Created page with "Category:metabolite == Metabolite INDOLE-3-GLYCOL == * common-name: ** indole-3-glycol * inchi-key: ** xnjdzrgywqbbmz-uhfffaoysa-n * molecular-weight: ** 177.202 * smiles:...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite INDOLE-3-GLYCOL == |
* common-name: | * common-name: | ||
| − | ** | + | ** indole-3-glycol |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** xnjdzrgywqbbmz-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 177.202 |
* smiles: | * smiles: | ||
| − | ** | + | ** c1(\nc2(\c=cc=cc(/c(\c(o)co)=1)=2)) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-5424]] |
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=indole-3-glycol}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=xnjdzrgywqbbmz-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=177.202}} |
Revision as of 10:04, 10 September 2020
Contents
Metabolite INDOLE-3-GLYCOL
- common-name:
- indole-3-glycol
- inchi-key:
- xnjdzrgywqbbmz-uhfffaoysa-n
- molecular-weight:
- 177.202
- smiles:
- c1(\nc2(\c=cc=cc(/c(\c(o)co)=1)=2))
