Difference between revisions of "RXN0-382"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-205 == * common-name: ** pimelate * inchi-key: ** wljvntcwhirura-uhfffaoysa-l * molecular-weight: ** 158.154 * smiles: ** c([o-])(=o)...")
(Created page with "Category:metabolite == Metabolite DUTP == * common-name: ** dutp * inchi-key: ** ahcymluzirlxaa-shyzeuofsa-j * molecular-weight: ** 464.112 * smiles: ** c([c@h]2([c@h](c[c...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-205 ==
+
== Metabolite DUTP ==
 
* common-name:
 
* common-name:
** pimelate
+
** dutp
 
* inchi-key:
 
* inchi-key:
** wljvntcwhirura-uhfffaoysa-l
+
** ahcymluzirlxaa-shyzeuofsa-j
 
* molecular-weight:
 
* molecular-weight:
** 158.154
+
** 464.112
 
* smiles:
 
* smiles:
** c([o-])(=o)cccccc([o-])=o
+
** c([c@h]2([c@h](c[c@h](n1(c(nc(c=c1)=o)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[6-CARBOXYHEXANOATE--COA-LIGASE-RXN]]
+
* [[DUTP-PYROP-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[DUDPKIN-RXN]]
 +
* [[RXN0-724]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pimelate}}
+
{{#set: common-name=dutp}}
{{#set: inchi-key=inchikey=wljvntcwhirura-uhfffaoysa-l}}
+
{{#set: inchi-key=inchikey=ahcymluzirlxaa-shyzeuofsa-j}}
{{#set: molecular-weight=158.154}}
+
{{#set: molecular-weight=464.112}}

Revision as of 17:42, 22 September 2020

Metabolite DUTP

  • common-name:
    • dutp
  • inchi-key:
    • ahcymluzirlxaa-shyzeuofsa-j
  • molecular-weight:
    • 464.112
  • smiles:
    • c([c@h]2([c@h](c[c@h](n1(c(nc(c=c1)=o)=o))o2)o))op(op(op(=o)([o-])[o-])([o-])=o)([o-])=o

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality