Difference between revisions of "5-AMINOLEVULINIC-ACID-SYNTHASE-RXN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-15301 == * common-name: ** caldariellaquinol * inchi-key: ** uvcqokdzgiahdg-uhfffaoysa-n * molecular-weight: ** 633.085 * smiles: **...")
(Created page with "Category:metabolite == Metabolite TAGATOSE-1-6-DIPHOSPHATE == * common-name: ** d-tagatofuranose 1,6-bisphosphate * inchi-key: ** rnbgygvwrkecfj-oexcpvawsa-j * molecular-w...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-15301 ==
+
== Metabolite TAGATOSE-1-6-DIPHOSPHATE ==
 
* common-name:
 
* common-name:
** caldariellaquinol
+
** d-tagatofuranose 1,6-bisphosphate
 
* inchi-key:
 
* inchi-key:
** uvcqokdzgiahdg-uhfffaoysa-n
+
** rnbgygvwrkecfj-oexcpvawsa-j
 
* molecular-weight:
 
* molecular-weight:
** 633.085
+
** 336.085
 
* smiles:
 
* smiles:
** cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc1(\c(/sc)=c(c2(/c=csc(/c(\o)=1)=2))/o)
+
** c(op([o-])(=o)[o-])[c@@h]1(oc(o)(cop([o-])([o-])=o)[c@@h](o)[c@h]1o)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15378]]
+
* [[TAGAKIN-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=caldariellaquinol}}
+
{{#set: common-name=d-tagatofuranose 1,6-bisphosphate}}
{{#set: inchi-key=inchikey=uvcqokdzgiahdg-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=rnbgygvwrkecfj-oexcpvawsa-j}}
{{#set: molecular-weight=633.085}}
+
{{#set: molecular-weight=336.085}}

Revision as of 17:43, 22 September 2020

Metabolite TAGATOSE-1-6-DIPHOSPHATE

  • common-name:
    • d-tagatofuranose 1,6-bisphosphate
  • inchi-key:
    • rnbgygvwrkecfj-oexcpvawsa-j
  • molecular-weight:
    • 336.085
  • smiles:
    • c(op([o-])(=o)[o-])[c@@h]1(oc(o)(cop([o-])([o-])=o)[c@@h](o)[c@h]1o)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality