Difference between revisions of "RXN-16380"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PYRIDOXAL == * common-name: ** pyridoxal * inchi-key: ** radkzdmfgjycbb-uhfffaoysa-n * molecular-weight: ** 167.164 * smiles: ** cc1(\n=c...")
(Created page with "Category:metabolite == Metabolite CPD0-2390 == * common-name: ** magnesium sulfate * molecular-weight: ** 120.363 == Reaction(s) known to consume the compound == * Excha...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PYRIDOXAL ==
+
== Metabolite CPD0-2390 ==
 
* common-name:
 
* common-name:
** pyridoxal
+
** magnesium sulfate
* inchi-key:
 
** radkzdmfgjycbb-uhfffaoysa-n
 
 
* molecular-weight:
 
* molecular-weight:
** 167.164
+
** 120.363
* smiles:
 
** cc1(\n=cc(/co)=c(c(\o)=1)/c=o)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PYRIDOXAL-4-DEHYDROGENASE-RXN]]
+
* [[ExchangeSeed-CPD0-2390]]
* [[PYRIDOXKIN-RXN]]
+
* [[TransportSeed-CPD0-2390]]
* [[PYROXALTRANSAM-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PYROXALTRANSAM-RXN]]
+
* [[ExchangeSeed-CPD0-2390]]
 +
* [[TransportSeed-CPD0-2390]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=pyridoxal}}
+
{{#set: common-name=magnesium sulfate}}
{{#set: inchi-key=inchikey=radkzdmfgjycbb-uhfffaoysa-n}}
+
{{#set: molecular-weight=120.363}}
{{#set: molecular-weight=167.164}}
 

Revision as of 17:44, 22 September 2020

Metabolite CPD0-2390

  • common-name:
    • magnesium sulfate
  • molecular-weight:
    • 120.363

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality