Difference between revisions of "ORNITHINE-CYCLODEAMINASE-RXN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite DEOXYURIDINE == * common-name: ** 2'-deoxyuridine * inchi-key: ** mxhrcpnrjammim-shyzeuofsa-n * molecular-weight: ** 228.204 * smiles: **...")
(Created page with "Category:metabolite == Metabolite 2-OCTAPRENYLPHENOL == * common-name: ** 2-octaprenylphenol * inchi-key: ** vunqjppptjiren-cmaxttdksa-n * molecular-weight: ** 639.058 * s...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite DEOXYURIDINE ==
+
== Metabolite 2-OCTAPRENYLPHENOL ==
 
* common-name:
 
* common-name:
** 2'-deoxyuridine
+
** 2-octaprenylphenol
 
* inchi-key:
 
* inchi-key:
** mxhrcpnrjammim-shyzeuofsa-n
+
** vunqjppptjiren-cmaxttdksa-n
 
* molecular-weight:
 
* molecular-weight:
** 228.204
+
** 639.058
 
* smiles:
 
* smiles:
** c1(/c(=o)nc(=o)n(c=1)[c@@h]2(c[c@h](o)[c@@h](co)o2))
+
** cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/cc1(/c(\o)=c/c=cc=1)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[DURIDKI-RXN]]
+
* [[2-OCTAPRENYLPHENOL-HYDROX-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-14143]]
+
* [[3-OCTAPRENYL-4-OHBENZOATE-DECARBOX-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=2'-deoxyuridine}}
+
{{#set: common-name=2-octaprenylphenol}}
{{#set: inchi-key=inchikey=mxhrcpnrjammim-shyzeuofsa-n}}
+
{{#set: inchi-key=inchikey=vunqjppptjiren-cmaxttdksa-n}}
{{#set: molecular-weight=228.204}}
+
{{#set: molecular-weight=639.058}}

Revision as of 17:45, 22 September 2020

Metabolite 2-OCTAPRENYLPHENOL

  • common-name:
    • 2-octaprenylphenol
  • inchi-key:
    • vunqjppptjiren-cmaxttdksa-n
  • molecular-weight:
    • 639.058
  • smiles:
    • cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/cc1(/c(\o)=c/c=cc=1)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality