Difference between revisions of "ORNITHINE-CYCLODEAMINASE-RXN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DEOXYURIDINE == * common-name: ** 2'-deoxyuridine * inchi-key: ** mxhrcpnrjammim-shyzeuofsa-n * molecular-weight: ** 228.204 * smiles: **...") |
(Created page with "Category:metabolite == Metabolite 2-OCTAPRENYLPHENOL == * common-name: ** 2-octaprenylphenol * inchi-key: ** vunqjppptjiren-cmaxttdksa-n * molecular-weight: ** 639.058 * s...") |
||
Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
− | == Metabolite | + | == Metabolite 2-OCTAPRENYLPHENOL == |
* common-name: | * common-name: | ||
− | ** 2 | + | ** 2-octaprenylphenol |
* inchi-key: | * inchi-key: | ||
− | ** | + | ** vunqjppptjiren-cmaxttdksa-n |
* molecular-weight: | * molecular-weight: | ||
− | ** | + | ** 639.058 |
* smiles: | * smiles: | ||
− | ** | + | ** cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/cc1(/c(\o)=c/c=cc=1) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[2-OCTAPRENYLPHENOL-HYDROX-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[3-OCTAPRENYL-4-OHBENZOATE-DECARBOX-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | {{#set: common-name=2 | + | {{#set: common-name=2-octaprenylphenol}} |
− | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=vunqjppptjiren-cmaxttdksa-n}} |
− | {{#set: molecular-weight= | + | {{#set: molecular-weight=639.058}} |
Revision as of 17:45, 22 September 2020
Contents
Metabolite 2-OCTAPRENYLPHENOL
- common-name:
- 2-octaprenylphenol
- inchi-key:
- vunqjppptjiren-cmaxttdksa-n
- molecular-weight:
- 639.058
- smiles:
- cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/cc1(/c(\o)=c/c=cc=1)