Difference between revisions of "2.6.1.18-RXN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite UDP-MANNAC == * common-name: ** udp-n-acetyl-α-d-mannosamine * inchi-key: ** lftytuazoprmmi-zyqoojpvsa-l * molecular-weight: ** 605...")
(Created page with "Category:metabolite == Metabolite CPD-12125 == * common-name: ** menaquinol-7 * inchi-key: ** vfgnpjrrtkmykn-ljwnyqgcsa-n * molecular-weight: ** 651.026 * smiles: ** cc(c)...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite UDP-MANNAC ==
+
== Metabolite CPD-12125 ==
 
* common-name:
 
* common-name:
** udp-n-acetyl-α-d-mannosamine
+
** menaquinol-7
 
* inchi-key:
 
* inchi-key:
** lftytuazoprmmi-zyqoojpvsa-l
+
** vfgnpjrrtkmykn-ljwnyqgcsa-n
 
* molecular-weight:
 
* molecular-weight:
** 605.342
+
** 651.026
 
* smiles:
 
* smiles:
** cc(=o)n[c@@h]3([c@@h](o)[c@h](o)[c@@h](co)o[c@h](op(=o)([o-])op(=o)([o-])oc[c@@h]1(o[c@h]([c@h](o)[c@h](o)1)n2(c=cc(=o)nc(=o)2)))3)
+
** cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/cc1(\c(/c)=c(c2(\c=cc=cc(/c(\o)=1)=2))/o)
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[TEICHOICSYN2-RXN]]
+
* [[biomass]]
* [[UDPGLCNACEPIM-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[UDPGLCNACEPIM-RXN]]
+
* [[RXN-9191]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=udp-n-acetyl-α-d-mannosamine}}
+
{{#set: common-name=menaquinol-7}}
{{#set: inchi-key=inchikey=lftytuazoprmmi-zyqoojpvsa-l}}
+
{{#set: inchi-key=inchikey=vfgnpjrrtkmykn-ljwnyqgcsa-n}}
{{#set: molecular-weight=605.342}}
+
{{#set: molecular-weight=651.026}}

Revision as of 17:47, 22 September 2020

Metabolite CPD-12125

  • common-name:
    • menaquinol-7
  • inchi-key:
    • vfgnpjrrtkmykn-ljwnyqgcsa-n
  • molecular-weight:
    • 651.026
  • smiles:
    • cc(c)=cccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/ccc(/c)=c/cc1(\c(/c)=c(c2(\c=cc=cc(/c(\o)=1)=2))/o)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality