Difference between revisions of "3.1.26.4-RXN"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite L-LACTATE == * common-name: ** (s)-lactate * inchi-key: ** jvtaaekczfnvcj-reohclbhsa-m * molecular-weight: ** 89.071 * smiles: ** c[c@@h]...") |
(Created page with "Category:metabolite == Metabolite AMINO-OH-HYDROXYMETHYL-DIHYDROPTERIDINE == * common-name: ** 6-(hydroxymethyl)-7,8-dihydropterin * inchi-key: ** cqqnnqtxugluev-uhfffaoys...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite AMINO-OH-HYDROXYMETHYL-DIHYDROPTERIDINE == |
* common-name: | * common-name: | ||
| − | ** ( | + | ** 6-(hydroxymethyl)-7,8-dihydropterin |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** cqqnnqtxugluev-uhfffaoysa-n |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 195.18 |
* smiles: | * smiles: | ||
| − | ** c | + | ** c(o)c1(=nc2(/c(=o)nc(n)=nc(/nc1)=2)) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[H2PTERIDINEPYROPHOSPHOKIN-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[H2NEOPTERINALDOL-RXN]] |
| − | * [[ | + | * [[RXN-10857]] |
| + | * [[RXN-18377]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name=( | + | {{#set: common-name=6-(hydroxymethyl)-7,8-dihydropterin}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=cqqnnqtxugluev-uhfffaoysa-n}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=195.18}} |
Revision as of 17:48, 22 September 2020
Contents
Metabolite AMINO-OH-HYDROXYMETHYL-DIHYDROPTERIDINE
- common-name:
- 6-(hydroxymethyl)-7,8-dihydropterin
- inchi-key:
- cqqnnqtxugluev-uhfffaoysa-n
- molecular-weight:
- 195.18
- smiles:
- c(o)c1(=nc2(/c(=o)nc(n)=nc(/nc1)=2))
