Difference between revisions of "ASPAMINOTRANS-RXN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite 7-CYANO-7-DEAZAGUANINE == * common-name: ** preq0 * inchi-key: ** fmksmydykxqyrv-uhfffaoysa-n * molecular-weight: ** 175.149 * smiles: **...")
(Created page with "Category:metabolite == Metabolite Myo-inositol-monophosphates == * common-name: ** a myo-inositol monophosphate == Reaction(s) known to consume the compound == * RXN-109...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite 7-CYANO-7-DEAZAGUANINE ==
+
== Metabolite Myo-inositol-monophosphates ==
 
* common-name:
 
* common-name:
** preq0
+
** a myo-inositol monophosphate
* inchi-key:
 
** fmksmydykxqyrv-uhfffaoysa-n
 
* molecular-weight:
 
** 175.149
 
* smiles:
 
** c12(=c(c(nc(=n1)n)=o)c(\c#n)=c/n2)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN0-4022]]
+
* [[RXN-10949]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-12093]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=preq0}}
+
{{#set: common-name=a myo-inositol monophosphate}}
{{#set: inchi-key=inchikey=fmksmydykxqyrv-uhfffaoysa-n}}
 
{{#set: molecular-weight=175.149}}
 

Revision as of 07:07, 24 September 2020

Metabolite Myo-inositol-monophosphates

  • common-name:
    • a myo-inositol monophosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality