Difference between revisions of "D-ALANINE-AMINOTRANSFERASE-RXN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite PHENYLACETATE == * common-name: ** phenylacetate * inchi-key: ** wljvxdmoqogphl-uhfffaoysa-m * molecular-weight: ** 135.142 * smiles: **...")
(Created page with "Category:metabolite == Metabolite DNA-containing-abasic-Sites == * common-name: ** a dna containing an apurinic/apyrimidinic site == Reaction(s) known to consume the compo...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite PHENYLACETATE ==
+
== Metabolite DNA-containing-abasic-Sites ==
 
* common-name:
 
* common-name:
** phenylacetate
+
** a dna containing an apurinic/apyrimidinic site
* inchi-key:
 
** wljvxdmoqogphl-uhfffaoysa-m
 
* molecular-weight:
 
** 135.142
 
* smiles:
 
** c([o-])(=o)cc1(/c=cc=cc=1)
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[PHENDEHYD-RXN]]
+
* [[4.2.99.18-RXN]]
* [[RXN-10819]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[PHENDEHYD-RXN]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=phenylacetate}}
+
{{#set: common-name=a dna containing an apurinic/apyrimidinic site}}
{{#set: inchi-key=inchikey=wljvxdmoqogphl-uhfffaoysa-m}}
 
{{#set: molecular-weight=135.142}}
 

Revision as of 07:10, 24 September 2020

Metabolite DNA-containing-abasic-Sites

  • common-name:
    • a dna containing an apurinic/apyrimidinic site

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality