Difference between revisions of "ADENOSINE-NUCLEOSIDASE-RXN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite CPD-9612 == * common-name: ** caldariellaquinone * inchi-key: ** ghrwxpxobgrshg-uhfffaoysa-n * molecular-weight: ** 631.069 * smiles: **...")
(Created page with "Category:metabolite == Metabolite CPD-196 == * common-name: ** octanoyl-coa * inchi-key: ** kqmzyoxobsxmii-cecatxlmsa-j * molecular-weight: ** 889.7 * smiles: ** cccccccc(...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite CPD-9612 ==
+
== Metabolite CPD-196 ==
 
* common-name:
 
* common-name:
** caldariellaquinone
+
** octanoyl-coa
 
* inchi-key:
 
* inchi-key:
** ghrwxpxobgrshg-uhfffaoysa-n
+
** kqmzyoxobsxmii-cecatxlmsa-j
 
* molecular-weight:
 
* molecular-weight:
** 631.069
+
** 889.7
 
* smiles:
 
* smiles:
** cc(c)cccc(c)cccc(c)cccc(c)cccc(c)cccc(c)ccc1(\c(=o)c2(\sc=cc(\c(=o)c(\sc)=1)=2))
+
** cccccccc(=o)sccnc(=o)ccnc(=o)[c@h](o)c(c)(c)cop(=o)(op(=o)(oc[c@h]1([c@@h](op([o-])(=o)[o-])[c@@h](o)[c@@h](o1)n2(c3(n=cn=c(c(n=c2)=3)n))))[o-])[o-]
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-15378]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[R223-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=caldariellaquinone}}
+
{{#set: common-name=octanoyl-coa}}
{{#set: inchi-key=inchikey=ghrwxpxobgrshg-uhfffaoysa-n}}
+
{{#set: inchi-key=inchikey=kqmzyoxobsxmii-cecatxlmsa-j}}
{{#set: molecular-weight=631.069}}
+
{{#set: molecular-weight=889.7}}

Revision as of 07:10, 24 September 2020

Metabolite CPD-196

  • common-name:
    • octanoyl-coa
  • inchi-key:
    • kqmzyoxobsxmii-cecatxlmsa-j
  • molecular-weight:
    • 889.7
  • smiles:
    • cccccccc(=o)sccnc(=o)ccnc(=o)[c@h](o)c(c)(c)cop(=o)(op(=o)(oc[c@h]1([c@@h](op([o-])(=o)[o-])[c@@h](o)[c@@h](o1)n2(c3(n=cn=c(c(n=c2)=3)n))))[o-])[o-]

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality