Difference between revisions of "3.1.26.4-RXN"

From metabolic_network
Jump to navigation Jump to search
(Created page with "Category:metabolite == Metabolite AMINO-OH-HYDROXYMETHYL-DIHYDROPTERIDINE == * common-name: ** 6-(hydroxymethyl)-7,8-dihydropterin * inchi-key: ** cqqnnqtxugluev-uhfffaoys...")
(Created page with "Category:metabolite == Metabolite a-double-stranded-DNA-with-a-blunt-end == * common-name: ** a chi-site containing double stranded dna with a blunt end == Reaction(s) kno...")
Line 1: Line 1:
 
[[Category:metabolite]]
 
[[Category:metabolite]]
== Metabolite AMINO-OH-HYDROXYMETHYL-DIHYDROPTERIDINE ==
+
== Metabolite a-double-stranded-DNA-with-a-blunt-end ==
 
* common-name:
 
* common-name:
** 6-(hydroxymethyl)-7,8-dihydropterin
+
** a chi-site containing double stranded dna with a blunt end
* inchi-key:
 
** cqqnnqtxugluev-uhfffaoysa-n
 
* molecular-weight:
 
** 195.18
 
* smiles:
 
** c(o)c1(=nc2(/c(=o)nc(n)=nc(/nc1)=2))
 
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[H2PTERIDINEPYROPHOSPHOKIN-RXN]]
+
* [[RXN-19004]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[H2NEOPTERINALDOL-RXN]]
 
* [[RXN-10857]]
 
* [[RXN-18377]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
{{#set: common-name=6-(hydroxymethyl)-7,8-dihydropterin}}
+
{{#set: common-name=a chi-site containing double stranded dna with a blunt end}}
{{#set: inchi-key=inchikey=cqqnnqtxugluev-uhfffaoysa-n}}
 
{{#set: molecular-weight=195.18}}
 

Revision as of 07:11, 24 September 2020

Metabolite a-double-stranded-DNA-with-a-blunt-end

  • common-name:
    • a chi-site containing double stranded dna with a blunt end

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality