Difference between revisions of "MALTOHEXAOSE"
Jump to navigation
Jump to search
(Created page with "Category:metabolite == Metabolite DIHYDROMONAPTERIN-TRIPHOSPHATE == * common-name: ** 7,8-dihydromonapterin triphosphate * inchi-key: ** dgguvlxvlhaagt-njgyiypdsa-j * mole...") |
(Created page with "Category:metabolite == Metabolite FERULIC-ACID == * common-name: ** ferulate * inchi-key: ** ksebmyqbyztdhs-hwkanzrosa-m * molecular-weight: ** 193.179 * smiles: ** coc1(/...") |
||
| Line 1: | Line 1: | ||
[[Category:metabolite]] | [[Category:metabolite]] | ||
| − | == Metabolite | + | == Metabolite FERULIC-ACID == |
* common-name: | * common-name: | ||
| − | ** | + | ** ferulate |
* inchi-key: | * inchi-key: | ||
| − | ** | + | ** ksebmyqbyztdhs-hwkanzrosa-m |
* molecular-weight: | * molecular-weight: | ||
| − | ** | + | ** 193.179 |
* smiles: | * smiles: | ||
| − | ** | + | ** coc1(/c(\o)=c/c=c(c=cc([o-])=o)c=1) |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[3.1.1.73-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | {{#set: common-name= | + | {{#set: common-name=ferulate}} |
| − | {{#set: inchi-key=inchikey= | + | {{#set: inchi-key=inchikey=ksebmyqbyztdhs-hwkanzrosa-m}} |
| − | {{#set: molecular-weight= | + | {{#set: molecular-weight=193.179}} |
Revision as of 07:41, 5 October 2020
Contents
Metabolite FERULIC-ACID
- common-name:
- ferulate
- inchi-key:
- ksebmyqbyztdhs-hwkanzrosa-m
- molecular-weight:
- 193.179
- smiles:
- coc1(/c(\o)=c/c=c(c=cc([o-])=o)c=1)
