Difference between revisions of "6.3.1.4-RXN"

Revision as of 07:46, 5 October 2020

@@ Line 1: / Line 1: @@
 [[Category:metabolite]]
-== Metabolite GUANOSINE-5DP-3DP ==
+== Metabolite HOMO-CIT ==
 * common-name:
-** ppgpp
+** (2r)-homocitrate
 * inchi-key:
-** bufllcufnheseh-uuokfmhzsa-i
+** xkjvevrqmlksmo-ssdottswsa-k
 * molecular-weight:
-** 598.123
+** 203.128
 * smiles:
-** c(op(=o)([o-])op(=o)(o)[o-])[c@@h]1(o[c@h]([c@h](o)[c@h](op([o-])(=o)op([o-])([o-])=o)1)n2(c=nc3(c(=o)nc(n)=nc2=3)))
+** c(c([o-])=o)c[c@](o)(c([o-])=o)cc([o-])=o
 == Reaction(s) known to consume the compound ==
-* [[PPGPPSYN-RXN]]
+* [[HOMOCITRATE-SYNTHASE-RXN]]
+* [[RXN-13722]]
 == Reaction(s) known to produce the compound ==
-* [[GDPPYPHOSKIN-RXN]]
+* [[HOMOCITRATE-SYNTHASE-RXN]]
-* [[PPPGPPHYDRO-RXN]]
+* [[RXN-13722]]
 == Reaction(s) of unknown directionality ==
-{{#set: common-name=ppgpp}}
+{{#set: common-name=(2r)-homocitrate}}
-{{#set: inchi-key=inchikey=bufllcufnheseh-uuokfmhzsa-i}}
+{{#set: inchi-key=inchikey=xkjvevrqmlksmo-ssdottswsa-k}}
-{{#set: molecular-weight=598.123}}
+{{#set: molecular-weight=203.128}}